|
|
| | 1,2-BIS(TRIMETHYLSILYLOXY)CYCLOBUTENE Basic information |
| | 1,2-BIS(TRIMETHYLSILYLOXY)CYCLOBUTENE Chemical Properties |
| Boiling point | 58-59 °C2 mm Hg(lit.) | | density | 0.897 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.435(lit.) | | Fp | 142 °F | | storage temp. | Inert atmosphere,2-8°C | | solubility | sol hydrocarbons and ethers. | | form | clear liquid | | Specific Gravity | 0.87 | | color | Colorless to Light yellow | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | BRN | 1367530 | | InChI | InChI=1S/C10H22O2Si2/c1-13(2,3)11-9-7-8-10(9)12-14(4,5)6/h7-8H2,1-6H3 | | InChIKey | WOBRFSDEZREQAB-UHFFFAOYSA-N | | SMILES | C1(O[Si](C)(C)C)CCC=1O[Si](C)(C)C | | CAS DataBase Reference | 17082-61-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | 1993 | | WGK Germany | 3 | | F | 10-21 | | TSCA | No | | HS Code | 2931.90.6000 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1,2-BIS(TRIMETHYLSILYLOXY)CYCLOBUTENE Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | 1,2-Bis(trimethylsilyloxy)cyclobutene is a useful chemical reactant used in the preparation and biological activity of serine and threonine β-lactones as inhibitors of hepatitis A virus 3C cysteine proteinase. | | Application | Used as a suitable reagent for annulation processes and 4-keto ester synthesis. | | General Description | Photocycloaddition of 2-cyclohexenones to 1,2-bis(trimethyl-siloxy)cyclobutene has been studied. It undergoes Aldol condensation reaction with carbonyl compounds. It reacts with Br2 to give cyclobutanedione. | | Synthesis | 1,2-Bis(trimethylsilyloxy)cyclobutene is prepared as a colorless liquid by acyloin condensation of Diethyl Succinate
(dispersed Na in toluene or Et2O, reflux) using Chlorotrimethylsilane as trapping agent. | | storage | Use in a fume hood; the compound is stable for years if stored in a
tightly screw-capped bottle. Prolonged exposure to moist air leads to decomposition. |
| | 1,2-BIS(TRIMETHYLSILYLOXY)CYCLOBUTENE Preparation Products And Raw materials |
|