| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:INT ForMazan
CAS:7781-49-9
Package:100MG
|
| Company Name: |
3B Pharmachem (Wuhan) International Co.,Ltd.
|
| Tel: |
821-50328103-801 18930552037 |
| Email: |
3bsc@sina.com |
| Products Intro: |
Product Name:INT FORMAZAN
CAS:7781-49-9
Purity:99% HPLC Package:1Mg ; 5Mg;10Mg ;100Mg;250Mg ;500Mg ;1g;2.5g ;5g ;10g
|
|
| | INT FORMAZAN Basic information |
| Product Name: | INT FORMAZAN | | Synonyms: | IODONITROTETRAZOLIUM FORMAZAN;INT FORMAZAN;5-(4-IODOPHENYL)-1-(4-NITROPHENYL)-3-PHENYLFORMAZAN;1-(4-Iodophenyl)-5-(4-nitrophenyl)-3-phenylformazan;iodonitrotetrazoliumviolet-formazane;1-(p-iodophenyl)-5-(p-nitrophenyl)-3-phenylformazan;iodonitrotetrazolium violet-formazan;P-IODONITROTETRAZOLIUM FORMAZAN | | CAS: | 7781-49-9 | | MF: | C19H14IN5O2 | | MW: | 471.25 | | EINECS: | 231-950-6 | | Product Categories: | Formazans;Tetrazolium Salts & Formazans | | Mol File: | 7781-49-9.mol |  |
| | INT FORMAZAN Chemical Properties |
| Melting point | 187 °C (dec.)(lit.) | | Boiling point | 564.9±60.0 °C(Predicted) | | density | 1.59±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMF: 50mg/mL | | form | crystalline | | pka | 9.53±0.10(Predicted) | | color | brown | | BRN | 1829738 | | InChI | 1S/C19H14IN5O2/c20-15-6-8-16(9-7-15)21-23-19(14-4-2-1-3-5-14)24-22-17-10-12-18(13-11-17)25(26)27/h1-13,22H/b23-21?,24-19- | | InChIKey | FVFWUNAWQMROIF-CDNKMLFNSA-N | | SMILES | [O-][N+](=O)c1ccc(NN=C(N=Nc2ccc(I)cc2)c3ccccc3)cc1 |
| Hazard Codes | Xi | | Risk Statements | 43 | | Safety Statements | 22-24/25-36/37 | | WGK Germany | 3 | | F | 8-10 | | HS Code | 2928.00.5000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Resp. Sens. 1 |
| | INT FORMAZAN Usage And Synthesis |
| Uses |
- Starvation-survival processes of a marine Vibrio.: This research explores the use of Iodonitrotetrazolium Violet-Formazan for studying the starvation-survival mechanisms in marine Vibrio, highlighting its application as a metabolic activity indicator under nutrient-deprived conditions, which is crucial for understanding bacterial survival strategies in natural aquatic environments (Amy et al., 1983).
| | Purification Methods | Dissolve it in boiling dioxane (20g in 300mL), add H2O (100mL) slowly, cool, filter and dry it in vacuo at 100o. Its solubility in CHCl3 is ~1%. [UV: Fox & Atkinson J Am Chem Soc 72 3629 1950, Beilstein 26 III/IV 1776.] |
| | INT FORMAZAN Preparation Products And Raw materials |
|