N-Acetyl-L-asparagine manufacturers
- N-Acetyl-L-asparagine
-
- $7.00 / 1KG
-
2019-09-02
- CAS: 4033-40-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: JD 355
|
| | N-Acetyl-L-asparagine Basic information |
| | N-Acetyl-L-asparagine Chemical Properties |
| Melting point | 168-170 °C | | alpha | [α]D20 -2~+2° (c=1, H2O) | | Boiling point | 588.7±45.0 °C(Predicted) | | density | 1.346±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | Acetic Acid (Slightly, Heated, Sonicated), DMSO (Slightly), Water (Slightly, Heated) | | pka | 3.45±0.10(Predicted) | | form | Solid | | color | White to Off-White | | BRN | 1726196 | | Major Application | peptide synthesis | | InChI | 1S/C6H10N2O4/c1-3(9)8-4(6(11)12)2-5(7)10/h4H,2H2,1H3,(H2,7,10)(H,8,9)(H,11,12)/t4-/m0/s1 | | InChIKey | HXFOXFJUNFFYMO-BYPYZUCNSA-N | | SMILES | CC(=O)N[C@@H](CC(N)=O)C(O)=O | | CAS DataBase Reference | 4033-40-3(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10-21 | | Storage Class | 11 - Combustible Solids |
| | N-Acetyl-L-asparagine Usage And Synthesis |
| Chemical Properties | White powder | | Uses | N2-Acetyl-L-asparagine is a reagent in the synthesis of three mer peptide pENW (pGlu-Asn-Trp) derivatives as antiplatelet aggregation pharmaceuticals. | | Definition | ChEBI: N-alpha-acetyl-L-asparagine is an asparagine derivative. | | reaction suitability | reaction type: solution phase peptide synthesis | | IC 50 | Human Endogenous Metabolite |
| | N-Acetyl-L-asparagine Preparation Products And Raw materials |
|