|
|
| | 1,3-DIAZA-SPIRO[4.4]NONANE-2,4-DIONE Basic information |
| Product Name: | 1,3-DIAZA-SPIRO[4.4]NONANE-2,4-DIONE | | Synonyms: | 5,5’-cyclopentanespirohydantoin;5,5-tetramethylenespirohydantoin;ba2839;5,5-TETRAMETHYLENEHYDANTOIN;1,3-DIAZA-SPIRO[4.4]NONANE-2,4-DIONE;1,3-diazaspiro[4.4]nonane-2,4-quinone;Hydantoin-5-spirocyclopentane;NSC 1024 | | CAS: | 699-51-4 | | MF: | C7H10N2O2 | | MW: | 154.17 | | EINECS: | | | Product Categories: | | | Mol File: | 699-51-4.mol | ![1,3-DIAZA-SPIRO[4.4]NONANE-2,4-DIONE Structure](CAS/GIF/699-51-4.gif) |
| | 1,3-DIAZA-SPIRO[4.4]NONANE-2,4-DIONE Chemical Properties |
| Melting point | 204-205℃ | | density | 1.31 | | storage temp. | 2-8°C | | solubility | DMSO: 2 mg/mL, clear | | form | powder | | pka | 10.46±0.20(Predicted) | | color | white to beige | | Appearance | White to off-white Solid | | InChI | InChI=1S/C7H10N2O2/c10-5-7(3-1-2-4-7)9-6(11)8-5/h1-4H2,(H2,8,9,10,11) | | InChIKey | JTTFXYHJDZZDQK-UHFFFAOYSA-N | | SMILES | N1C2(CCCC2)C(=O)NC1=O |
| | 1,3-DIAZA-SPIRO[4.4]NONANE-2,4-DIONE Usage And Synthesis |
| Uses | Non-toxic spiro-hydantoin, reverses plant vernalization epigenetically by reducing H3K27me3 at FLC, enabling heat-free control over flowering time.
DVR06, identified in Arabidopsis thaliana, induces devernalization, reversing the vernalized state at ambient temperatures. Its core function is reactivating the floral repressor FLC within the nucleus, notably in vascular and meristematic tissues. Mechanistically, DVR06 reduces repressive H3K27me3 histone methylation at the FLC locus and other genomic sites, while leaving active H3K4me3 marks unchanged. This epigenetic modulation delays flowering time and enhances vegetative growth. Possessing low toxicity and key hydantoin/spiro pharmacophores, DVR06 serves as a valuable chemical probe for epigenetic memory and holds potential for agricultural control over plant life cycles. |
| | 1,3-DIAZA-SPIRO[4.4]NONANE-2,4-DIONE Preparation Products And Raw materials |
|