|
|
| | Aminoguanidinium nitrate Basic information | | Uses |
| | Aminoguanidinium nitrate Chemical Properties |
| Melting point | 145-147 °C (lit.) | | Boiling point | 251.9°C (rough estimate) | | refractive index | 1.6000 (estimate) | | Fp | 2 °C | | storage temp. | 2-8°C | | solubility | soluble in DMSO, Methanol | | form | Fine Crystalline Powder | | color | White | | Water Solubility | Soluble in water. | | BRN | 3916056 | | InChI | InChI=1S/CH6N4.HNO3/c2-1(3)5-4;2-1(3)4/h4H2,(H4,2,3,5);(H,2,3,4) | | InChIKey | PMGFHEJUUBDCLU-UHFFFAOYSA-N | | SMILES | [N+]([O-])(=O)O.C(=N)(N)NN | | CAS DataBase Reference | 10308-82-4(CAS DataBase Reference) | | EPA Substance Registry System | Hydrazinecarboximidamide, mononitrate (10308-82-4) |
| Hazard Codes | O,Xi,Xn,F | | Risk Statements | 8-36/37/38-36-20/21/22-11 | | Safety Statements | 17-26-36-37/39-36/37-16 | | RIDADR | UN 1479 5.1/PG 2 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 5.1 | | PackingGroup | III | | HS Code | 29280000 | | Storage Class | 5.1B - Oxidizing hazardous materials | | Hazard Classifications | Eye Irrit. 2 Ox. Sol. 2 Skin Irrit. 2 STOT SE 3 |
| | Aminoguanidinium nitrate Usage And Synthesis |
| Uses | Aminoguanidine Nitrate is used in the synthesis of inhibitors of cathespin L used in tumor suppression and treatment. Also used in the synthesis of melanocortin-4 receptor agonists as potential antiobesity agents. | | Chemical Properties | WHITE FINE CRYSTALLINE POWDER | | Uses | Aminoguanidine nitrate is used as a pharmaceutical raw material. |
| | Aminoguanidinium nitrate Preparation Products And Raw materials |
|