|
|
| | PERFLUORO-2-METHYLPENTANE Basic information |
| Product Name: | PERFLUORO-2-METHYLPENTANE | | Synonyms: | PERFLUOROISOHEXANE;PERFLUORO-2-METHYLPENTANE;TETRADECAFLUORO-2-METHYLPENTANE;1,1,1,2,2,3,3,4,5,5,5-Undecafluoro-4-(trifluoromethyl)pentane;1,1,1,2,2,3,3,4,5,5,5-undecafluoro-4-(trifluoromethyl)-Pentane;2-Perfluoromethylpentane;Pentane, 1,1,1,2,2,3,3,4,5,5,5-undecafluoro-4-(trifluoromethyl)-;Pentane, undecafluoro-2-(trifluoromethyl)- | | CAS: | 355-04-4 | | MF: | C6F14 | | MW: | 338.04 | | EINECS: | 206-575-6 | | Product Categories: | Fluorous Chemistry;Fluorous Solvents;Synthetic Organic Chemistry | | Mol File: | 355-04-4.mol |  |
| | PERFLUORO-2-METHYLPENTANE Chemical Properties |
| Melting point | <-150°C | | Boiling point | 58°C | | density | 1,723 g/cm3 | | vapor pressure | 29kPa at 25℃ | | refractive index | <1.3000 | | form | liquid | | color | Clear | | Cosmetics Ingredients Functions | SKIN CONDITIONING - EMOLLIENT SKIN CONDITIONING | | InChI | InChI=1S/C14H10F12O3S/c1-7-2-4-8(5-3-7)30(27,28)29-6-10(17,18)12(21,22)14(25,26)13(23,24)11(19,20)9(15)16/h2-5,9H,6H2,1H3 | | InChIKey | ROVMKEZVKFJNBD-UHFFFAOYSA-N | | SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F | | LogP | 5.02 at 25℃ | | CAS DataBase Reference | 355-04-4(CAS DataBase Reference) | | EPA Substance Registry System | Perfluoroisohexane (355-04-4) |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | HS Code | 2914199090 | | Storage Class | 10 - Combustible liquids |
| | PERFLUORO-2-METHYLPENTANE Usage And Synthesis |
| Description | Perfluoroisohexane is the halocarbon. |
| | PERFLUORO-2-METHYLPENTANE Preparation Products And Raw materials |
| Raw materials | 1,1,1,2,2,3,4,4,5,5,5-undecafluoro-3-(trifluoromethyl)pentane-->Perfluoro(4-methylpent-2-ene)-->PERFLUORO(METHYLCYCLOPENTANE)-->Perfluoro-2-methyl-2-pentene-->2,3-Dimethylbutane-->2-methylpentane | | Preparation Products | DECAFLUOROISOBUTANE-->PERFLUORO(2,3-DIMETHYLBUTANE)-->Tetradecafluorohexane-->Carbon tetrafluoride |
|