|
|
| | [1,3-Bis(diphenylphosphino)propane]nickel(II) chloride Basic information | | Reaction |
| Product Name: | [1,3-Bis(diphenylphosphino)propane]nickel(II) chloride | | Synonyms: | DICHLORO[1,3-BIS-(DIPHENYLPHOSPHINO)PROPANE] NICKE;NICL2(DPPP)/ 1,3-BIS(DIPHENY PHOSPHINE) PROPANE NICKEL(II)CHLORIDE;1,3-Bis(diphenyl phosphine)propane nickel(II)dichloride;1,3-Bis-(diphenylphosphino)-propane nickel chloride;Dichlorobis(1,3-diphenylphosphino)propaneünickel(II), C 59.9%;(1,3-dppp)NiCl2, 1,3-Bis(diphenylphosphino)propane nickel(II) chloride;Dichloro1,3-Bis-(diphenylphosphino ) propane nickel (II)（DPPE.Nicl2） 98%;1,3-Bis(diphenylphosphino)propane nickel(II) chlor | | CAS: | 15629-92-2 | | MF: | C27H26Cl2NiP2 | | MW: | 542.04 | | EINECS: | 605-052-3 | | Product Categories: | metal-phosphine complexes;Ni;Boron, Nitrile, Thio,& TM-Cpds;Metal Compounds;Catalysts for Organic Synthesis;Classes of Metal Compounds;Homogeneous Catalysts;Metal Complexes;Ni (Nickel) Compounds;Synthetic Organic Chemistry;Transition Metal Compounds | | Mol File: | 15629-92-2.mol | ![[1,3-Bis(diphenylphosphino)propane]nickel(II) chloride Structure](CAS/GIF/15629-92-2.gif) |
| | [1,3-Bis(diphenylphosphino)propane]nickel(II) chloride Chemical Properties |
| Melting point | 213 °C (dec.)(lit.) | | storage temp. | Inert atmosphere,Room Temperature | | form | crystal | | color | red | | Water Solubility | insoluble | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | Exposure limits | NIOSH: IDLH 10 mg/m3; TWA 0.015 mg/m3 | | InChI | InChI=1S/C27H26P2.2ClH.Ni/c1-5-14-24(15-6-1)28(25-16-7-2-8-17-25)22-13-23-29(26-18-9-3-10-19-26)27-20-11-4-12-21-27;;;/h1-12,14-21H,13,22-23H2;2*1H;/q;;;+2/p-2 | | InChIKey | ZBQUMMFUJLOTQC-UHFFFAOYSA-L | | SMILES | P(C1=CC=CC=C1)(CCCP(C1C=CC=CC=1)C1C=CC=CC=1)C1C=CC=CC=1.[Ni](Cl)Cl | | CAS DataBase Reference | 15629-92-2(CAS DataBase Reference) |
| Hazard Codes | T,Xn | | Risk Statements | 49-36/37/38-42/43-40 | | Safety Statements | 53-26-36/37/39-45-24-22 | | RIDADR | 3282 | | WGK Germany | 3 | | F | 10-21 | | TSCA | No | | HS Code | 29319090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Carc. 1A
Eye Irrit. 2
Resp. Sens. 1
Skin Irrit. 2
Skin Sens. 1
STOT SE 3 |
| | [1,3-Bis(diphenylphosphino)propane]nickel(II) chloride Usage And Synthesis |
| Reaction |
- Nickel catalyst used in the N-heterocycle-directed cross-coupling of fluorinated arenes with organozinc reagents.
- Nickel catalyst used in the (E)-selective semihydrogenation of internal alkynes.
- Nickel catalyst used in the borylation of halides and pseudohalides.
| | Chemical Properties | red to red-brown powder or crystals | | Uses |
[1,3-Bis(diphenylphosphino)propane]nickel(II) chloride is used as an effective catalyst for Kumada coupling and Suzuki reactions. It also catalyzes other reactions to convert enol ethers, dithioacetals and vinyl sulfides to olefins. Further, it is used as a catalyst for preparation of block-copolythiophenes and solid state metathesis polycondensation.
| | Application | Catalyst for:
Synthesis of block-copolythiophenes
Suzuki-Miyaura cross-coupling reaction of aryl halides with arylboronic acids
Solid state metathesis polycondensation
Polymerization of poly(3-alkoxythiophene)s
Diastereoselective Nozaki-Hiyama-Kishi coupling reactions of C1-C19 fragment of macrolide antibiotic aplyronine A
Transfer condensation polymerization of conjugated polymers
[1,3-Bis(diphenylphosphino)propane]dichloronickel(II) can be used as a precursor to synthesize metal-fullerene coordination complexes by reduction method. | | reaction suitability | core: nickel
reaction type: Cross Couplings
reagent type: catalyst |
| | [1,3-Bis(diphenylphosphino)propane]nickel(II) chloride Preparation Products And Raw materials |
|