- Z-D-Asn-OH
-
- $0.00 / 1Box
-
2025-07-08
- CAS:4474-86-6
- Min. Order: 1Box
- Purity: 99%
- Supply Ability: 200kg
|
| | N-Carbobenzyloxy-D-asparagine Basic information |
| | N-Carbobenzyloxy-D-asparagine Chemical Properties |
| Melting point | 162-164°C | | Boiling point | 580.6±50.0 °C(Predicted) | | density | 1.355±0.06 g/cm3(Predicted) | | refractive index | -6.5 ° (C=1.6, AcOH) | | storage temp. | Sealed in dry,2-8°C | | solubility | almost transparency in hot Methanol | | pka | 3.77±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C12H14N2O5/c13-10(15)6-9(11(16)17)14-12(18)19-7-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H2,13,15)(H,14,18)(H,16,17)/t9-/m1/s1 | | InChIKey | FUCKRCGERFLLHP-SECBINFHSA-N | | SMILES | C(O)(=O)[C@@H](CC(N)=O)NC(OCC1=CC=CC=C1)=O | | CAS DataBase Reference | 4474-86-6(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 29225090 |
| | N-Carbobenzyloxy-D-asparagine Usage And Synthesis |
| Chemical Properties | White solids or powder | | Uses | Nα-Cbz-D-asparagine is an N-Cbz-protected form of D-Asparagine (A788960). D-Asparagine is an isomer of L-Asparagine (A790005) and is used by bacteria (such as Saccharomyces cerevisiae) as a sole nitrogen source for replication. L-Asparagine is also a competitive inhibitor of staphylococcal L-asparaginase and is used as a reagent to synthesize peptide antibiotics. |
| | N-Carbobenzyloxy-D-asparagine Preparation Products And Raw materials |
|