|
|
| | L-NORADRENALINE BITARTRATE Basic information |
| | L-NORADRENALINE BITARTRATE Chemical Properties |
| Melting point | 100-104 °C(lit.) | | refractive index | -11 ° (C=5, H2O) | | storage temp. | Refrigerator | | solubility | H2O: soluble50mg/mL, clear | | pka | 8.64(at 25℃) | | form | solid | | color | white | | Optical Rotation | [α]20/D 11.5±1°, c = 2% in H2O | | Water Solubility | water: 1mg/mL | | BRN | 4078502 | | InChI | InChI=1/C8H11NO3.C4H6O6/c9-4-8(12)5-1-2-6(10)7(11)3-5;5-1(3(7)8)2(6)4(9)10/h1-3,8,10-12H,4,9H2;1-2,5-6H,(H,7,8)(H,9,10)/t8-;1-,2-/s3 | | InChIKey | WNPNNLQNNJQYFA-KBOIKTAVNA-N | | SMILES | [C@H](C1C=CC(O)=C(O)C=1)(O)CN.[C@H](O)(C(=O)O)[C@@H](O)C(=O)O |&1:0,12,17,r| |
| Hazard Codes | T+ | | Risk Statements | 26/27/28-28 | | Safety Statements | 22-26-36/37/39-45-36/37-28 | | RIDADR | UN 2811 6.1/PG 2 | | WGK Germany | 3 | | RTECS | DN6750000 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 2937901500 | | Storage Class | 6.1B - Non-combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 1 Dermal
Acute Tox. 2 Oral |
| | L-NORADRENALINE BITARTRATE Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Noradrenaline bitartrate monohydrate (Levophed) is a direct alpha-adrenergic receptors stimulator.
Noradrenaline bitartrate monohydrate (Levophed) also directly stimulates the beta-adrenergic receptors of the heart (beta1-adrenergic receptors), but not th | | Uses | A demethylated precursor of epinephrine. | | Uses | Demethylated precursor of epinephrine (adrenaline). It is a sympathomimetic hormone produced by the adrenal gland. | | Biochem/physiol Actions | Norepinephrine bitartrate plays an important role in in vivo and in vitro development of pathogenic and indigenous bacteria. It acts as a vasoconstrictor and adrenergic neurotransmitter. | | in vivo |
Norepinephrine bitartrate monohydrate can be used to induce cardiomyopathy[5][6]
Induced Cardiomyopathy Model[5][6] Background Norepinephrine bitartrate monohydrate is a potent growth factor for cardiomyocytes. Long-term infusion of subhyperbaric doses of Norepinephrine bitartrate monohydrate in animals can cause increases in myocardial mass and left ventricular wall thickness. Norepinephrine bitartrate monohydrate activates the Raf-1 kinase/MAP kinase cascade through α1- and β-adrenergic stimulation, and signaling pathways from both receptors synergistically induce cardiomyocyte hypertrophy.
Specific Modeling Methods
Rat: Spragues-Dawley rats adult (6 months old) male
Administration: Continuously injected via an osmotic minipump 100 μg/kg/h or 200 μg/kg/h (Norepinephrine)
Modeling Indicators Molecular changes: Left ventricular Dnmt activity ↑; ROS generation ↑; lactate dehydrogenase release ↑; dystrophin expression ↑; FHL2 protein expression ↓
Gene Expression: Expression of Dnmt1, 3a, and 3b ↑; mRNA expression of fetal genes ANP, BNP, and βMHC in left ventricle ↑
Phenotypic observation: Myocardial infarction area ↑; blood pressure continues to rise; left ventricular mass ↑; left ventricular development pressure ↓; cardiac contractility ↓. Cardiac hypertrophy.
Correlated Product(s): / Opposite Product(s): 5-Aza-2’-deoxycytidine (HY-A0004), Prazosin (HY-B0193), Propranolol (HY-B0573B) | | IC 50 | α1-adrenergic receptor; α2-adrenergic receptor; Beta-1 adrenergic receptor; Microbial Metabolite; Human Endogenous Metabolite |
| | L-NORADRENALINE BITARTRATE Preparation Products And Raw materials |
|