| Company Name: |
S.Z. PhyStandard Bio-Tech. Co., Ltd.
|
| Tel: |
0755-4000505016 13380397412 |
| Email: |
3001272453@qq.com |
| Products Intro: |
Product Name:Peramivir Impurity 42 Purity:98%HPLC Package:10mg;25mg;50mg;100mg
|
|
| | methyl (4R)-4-{[(tert-butoxy)carbonyl]amino}cyclopent-1-ene-1-carboxylate Basic information | | Uses |
| | methyl (4R)-4-{[(tert-butoxy)carbonyl]amino}cyclopent-1-ene-1-carboxylate Chemical Properties |
| Boiling point | 340.6±42.0 °C(Predicted) | | density | 1.11±0.1 g/cm3(Predicted) | | pka | 11.90±0.40(Predicted) | | InChI | InChI=1S/C12H19NO4/c1-12(2,3)17-11(15)13-9-6-5-8(7-9)10(14)16-4/h5,9H,6-7H2,1-4H3,(H,13,15)/t9-/m1/s1 | | InChIKey | BPVUUOLKMLXVJR-SECBINFHSA-N | | SMILES | C1(C(OC)=O)C[C@H](NC(OC(C)(C)C)=O)CC=1 |
| | methyl (4R)-4-{[(tert-butoxy)carbonyl]amino}cyclopent-1-ene-1-carboxylate Usage And Synthesis |
| Uses | This product is an impurity of peramivir and is used as a reference standard. |
| | methyl (4R)-4-{[(tert-butoxy)carbonyl]amino}cyclopent-1-ene-1-carboxylate Preparation Products And Raw materials |
|