| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 3,4,5-Tribromobiphenyl Basic information |
| Product Name: | 3,4,5-Tribromobiphenyl | | Synonyms: | PBB NO 38;1,1'-Biphenyl, 3,4',5-tribromo-;3,4',5-Tribromobiphenyl;3,4,5-Tribromobiphenyl | | CAS: | 72416-87-6 | | MF: | C12H7Br3 | | MW: | 390.89 | | EINECS: | | | Product Categories: | Aryl;Building Blocks;C9 to C12;Chemical Synthesis;Halogenated Hydrocarbons;Organic Building Blocks | | Mol File: | Mol File |  |
| | 3,4,5-Tribromobiphenyl Chemical Properties |
| Melting point | 87-97 °C | | Boiling point | 379.995±27.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.923±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | form | powder | | InChI | 1S/C12H7Br3/c13-10-3-1-8(2-4-10)9-5-11(14)7-12(15)6-9/h1-7H | | InChIKey | PMLLBFUHDNYTAP-UHFFFAOYSA-N | | SMILES | Brc1ccc(cc1)-c2cc(Br)cc(Br)c2 |
| Hazard Codes | Xi,N | | Risk Statements | 37/38-41-50/53 | | Safety Statements | 26-39-60-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
Eye Dam. 1
Skin Irrit. 2
STOT SE 3 |
| | 3,4,5-Tribromobiphenyl Usage And Synthesis |
| Uses | 3,4'',5-Tribromo-1,1''-biphenyl is used as a reactant in the synthesis of aromatic compounds as an electroluminescent host or hole transport material for organic electroluminescent devices. |
| | 3,4,5-Tribromobiphenyl Preparation Products And Raw materials |
|