|
|
| | 1,3-Dimethylpiperidin-4-one Basic information |
| Product Name: | 1,3-Dimethylpiperidin-4-one | | Synonyms: | AKOS BC-0316;1,3-DIMETHYL-PIPERIDIN-4-ONE;1,3-DIMETHYL-4-PIPERIDINONE;1,3-DIMETHYL-4-PIPERIDONE;1,3-Dimethyl-4-oxopiperidine;1,3-Dimethylpiperidi;N-Methyl-3-methyl-4-piperidoNe;4-Piperidinone, 1,3-dimethyl- | | CAS: | 4629-80-5 | | MF: | C7H13NO | | MW: | 127.18 | | EINECS: | 225-046-0 | | Product Categories: | Piperazines;Pyrans, Piperidines & Piperazines;Miscellaneous;Pyrans, Piperidines &Piperazines;Building Blocks/Intermediates | | Mol File: | 4629-80-5.mol |  |
| | 1,3-Dimethylpiperidin-4-one Chemical Properties |
| Boiling point | 62°C/12mmHg(lit.) | | density | 0.950 | | refractive index | 1.4580 | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Oil | | pka | 8.06±0.40(Predicted) | | color | Clear Light Yellow | | InChI | InChI=1S/C7H13NO/c1-6-5-8(2)4-3-7(6)9/h6H,3-5H2,1-2H3 | | InChIKey | BGDGMIWDPMJYPP-UHFFFAOYSA-N | | SMILES | N1(C)CCC(=O)C(C)C1 | | CAS DataBase Reference | 4629-80-5(CAS DataBase Reference) |
| | 1,3-Dimethylpiperidin-4-one Usage And Synthesis |
| Chemical Properties | Colorless liquid | | Uses | 1,3-Dimethylpiperidin-4-one is a key intermediate used in the preparation of Alvimopan, an Opiod drug. |
| | 1,3-Dimethylpiperidin-4-one Preparation Products And Raw materials |
|