|
|
| | LEAD MOLYBDATE Basic information |
| | LEAD MOLYBDATE Chemical Properties |
| Melting point | 1060-1070°C | | density | 6,92 g/cm3 | | solubility | insoluble in H2O; soluble in HNO3,
NaOH | | form | yellow tetragonal crystals | | color | yellow tetragonal crystals, crystalline | | Water Solubility | 0.000012g/100g H2O; soluble HNO3, NaOH when freshly precipitated [HAW93] [MER06] [KIR81] | | Merck | 13,5430 | | Solubility Product Constant (Ksp) | pKsp: 13 | | Exposure limits | ACGIH: TWA 10 mg/m3; TWA 3 mg/m3; TWA 0.05 mg/m3
NIOSH: IDLH 5000 mg/m3; IDLH 100 mg/m3; TWA 0.050 mg/m3 | | InChI | 1S/Mo.4O.Pb/q;;;2*-1;+2 | | InChIKey | XJUNRGGMKUAPAP-UHFFFAOYSA-N | | SMILES | [PbH2++].[O-][Mo]([O-])(=O)=O | | CAS DataBase Reference | 10190-55-3(CAS DataBase Reference) | | EPA Substance Registry System | Lead molybdenum oxide (PbMoO4) (10190-55-3) |
| Hazard Codes | T,N | | Risk Statements | 61-20/22-33-50/53-62 | | Safety Statements | 53-45-60-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 6.1 | | PackingGroup | III | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1
Repr. 1A
STOT RE 2 |
| | LEAD MOLYBDATE Usage And Synthesis |
| Chemical Properties | white; scheelite structure,?c/a=2.23; used in pigments and as an analytical reagent [HAW93] [KIR81] | | Chemical Properties | wulfenite is a brittle mineral; hardness, 2.75–3; specific gravity, 6.5–7; luster, adamantine to resinous; color, yellowish to green or red, may be whitish or grayish; transparent to translucent. | | Uses | Catalyst for photocatalytic reactions | | Uses | In pigments. | | reaction suitability | core: lead
reagent type: catalyst |
| | LEAD MOLYBDATE Preparation Products And Raw materials |
|