Pentadecafluorooctanoyl chloride manufacturers
|
| | Pentadecafluorooctanoyl chloride Basic information |
| Product Name: | Pentadecafluorooctanoyl chloride | | Synonyms: | PERFLUOROOCTANYL CHLORIDE;PERFLUOROOCTANOYL CHLORIDE;PENTADECAFLUOROOCTANOYL CHLORIDE;2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Pentadecafluorooctanoyl chloride;n-Perfluorooctanoyl chloride;Octanoyl chloride, pentadecafluoro-;Perfluorocaprylic chloride;Perfluorooctanoic acid chloride | | CAS: | 335-64-8 | | MF: | C8ClF15O | | MW: | 432.51 | | EINECS: | 206-394-2 | | Product Categories: | Rf-Tagged Building Blocks and Precursors;Fluorous Synthesis;Specialty Synthesis | | Mol File: | 335-64-8.mol |  |
| | Pentadecafluorooctanoyl chloride Chemical Properties |
| Melting point | 74-75 °C(Solv: benzene (71-43-2)) | | Boiling point | 129-130 °C/744 mmHg (lit.) | | density | 1.744 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.3045(lit.) | | Fp | >230 °F | | storage temp. | Store below +30°C. | | Water Solubility | Reacts with water. | | Sensitive | Moisture Sensitive | | BRN | 1809677 | | InChI | 1S/C8ClF15O/c9-1(25)2(10,11)3(12,13)4(14,15)5(16,17)6(18,19)7(20,21)8(22,23)24 | | InChIKey | AQQBRCXWZZAFOK-UHFFFAOYSA-N | | SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(Cl)=O | | CAS DataBase Reference | 335-64-8(CAS DataBase Reference) | | NIST Chemistry Reference | Perfluorooctanoyl chloride(335-64-8) | | EPA Substance Registry System | Pentadecafluorooctyl chloride (335-64-8) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 3 | | Hazard Note | Corrosive | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29159080 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Carc. 2
Eye Dam. 1
Lact.
Repr. 1B
STOT RE 1 |
| | Pentadecafluorooctanoyl chloride Usage And Synthesis |
| Uses | Perfluorooctanoyl chloride is derivatizated and used in the determination of Amphetamine and Methamphetamine in Blood. It can be used in agrochemical, pharmaceutical and dyestuff field . | | Uses | Pentadecafluorooctanoyl chloride can be used:
- In the derivatization of poly(2-hydroxyethyl methacrylate) (PHEMA) via esterification for use as composite membranes.
- In the fabrication of superhydrophobic cellulose surfaces.
- As a reagent for the esterification of hydroxyl-functionalized gold nanocrystals.
- As a reagent in the synthesis of fluorous derivatives of diaminocyclohexane which are used as ligands.
|
| | Pentadecafluorooctanoyl chloride Preparation Products And Raw materials |
|