- Fmoc-Ser(Ac3GalNAcα)-OH
-
- $0.00 / 500mg
-
2020-03-26
- CAS:120173-57-1
- Min. Order: 100mg
- Purity: 97%HPLC
- Supply Ability: MG-KG
|
| | FMOC-SER(GALNAC(AC)3-ALPHA-D)-OH Basic information |
| | FMOC-SER(GALNAC(AC)3-ALPHA-D)-OH Chemical Properties |
| Boiling point | 856.8±65.0 °C(Predicted) | | density | 1.39±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMF: 16 mg/mL; DMSO: 14 mg/mL; Ethanol: 14 mg/mL; PBS (pH 7.2): 0.3 mg/mL | | pka | 3.34±0.10(Predicted) | | form | A solid | | color | White to off-white | | Major Application | peptide synthesis | | InChIKey | ORICVOOXZDVFIP-VOZJJELXSA-N | | SMILES | C1(COC(=O)N[C@H](C(=O)O)CO[C@H]2O[C@@H]([C@H](OC(=O)C)[C@H](OC(=O)C)[C@H]2NC(=O)C)COC(=O)C)C2C=CC=CC=2C2C=CC=CC1=2 |&1:6,12,14,15,20,25,r| |
| WGK Germany | 3 | | HS Code | 2932 99 00 | | Storage Class | 11 - Combustible Solids |
| | FMOC-SER(GALNAC(AC)3-ALPHA-D)-OH Usage And Synthesis |
| Uses | Fluorescently labeled glycopeptides containing GalNAcα1-O-Ser/Thr residues provide valuable immunology probes for the development of cancer vaccines. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-SER(GALNAC(AC)3-ALPHA-D)-OH Preparation Products And Raw materials |
|