| Company Name: |
Shenzhen Sendi Biotechnology Co.Ltd.
|
| Tel: |
0755-23311925 18102838259 |
| Email: |
Abel@chembj.com |
| Products Intro: |
Product Name:Taxifolin
CAS:24198-97-8
Purity:98% Package:37800/KG
|
| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:(±)-Taxifolin hydrate, 90%
CAS:24198-97-8
Purity:90% Package:100MG;25MG
|
|
| | (+/-)-TAXIFOLIN Basic information |
| Product Name: | (+/-)-TAXIFOLIN | | Synonyms: | (+/-)-DIHYDROQUERCETIN;DIHYDROQUERCETIN;3,5,7,3',4'-PENTAHYDROXYFLAVANONE;(+/-)-3,3',4',5,7-PENTAHYDROXYFLAVANONE;3,3',4',5,7-PENTAHYDROXYFLAVANONE;(±)-Taxifolin Hydrate - CAS 24198-97-8 - Calbiochem;4H-1-Benzopyran-4-one,2-(3,4-dihydroxyphenyl)-2,3-dihydro-3,5,7-trihydroxy-, (2R,3R)-rel-;3,3',4',5,7-Pentahydroxyflavonone=Dihydroquercetin | | CAS: | 24198-97-8 | | MF: | C15H12O7 | | MW: | 304.25 | | EINECS: | | | Product Categories: | Dihydro-Flavanols;Tyrosine Kinase Inhibitors | | Mol File: | 24198-97-8.mol |  |
| | (+/-)-TAXIFOLIN Chemical Properties |
| Melting point | 239-240°C | | Boiling point | 687.6±55.0 °C(Predicted) | | density | 1.702±0.06 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | DMSO: soluble20mg/mL | | form | White to off-white solid | | pka | 7.39±0.60(Predicted) | | color | Off-White to Pale Yellow | | InChI | 1S/C15H12O7.H2O/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6;/h1-5,14-19,21H;1H2/t14-,15+;/m0./s1 | | InChIKey | DNQPGSVMBPSRIR-LDXVYITESA-N | | SMILES | O.O[C@@H]1[C@H](Oc2cc(O)cc(O)c2C1=O)c3ccc(O)c(O)c3 |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/37/38 | | Safety Statements | 36-26 | | WGK Germany | 3 | | RTECS | LK6920000 | | HS Code | 29329990 | | Storage Class | 11 - Combustible Solids |
| | (+/-)-TAXIFOLIN Usage And Synthesis |
| Chemical Properties | White to White with Yellow Cast Powder | | Uses | An antioxidant flavenoid. | | Definition | ChEBI: (+)-taxifolin is a taxifolin that has (2R,3R)-configuration. It has a role as a metabolite. It is a conjugate acid of a (+)-taxifolin(1-). It is an enantiomer of a (-)-taxifolin. | | Biological Activity | Cell permeable: no', 'Flavonoid, antioxidant. Inhibits lipogenesis in cancer cells, most likely by targeting fatty acid synthase activity.', 'Primary Target
An antioxidant flavonoid th at scavenges superoxide', 'Product does not compete with ATP.', 'Reversible: no |
| | (+/-)-TAXIFOLIN Preparation Products And Raw materials |
|