- 7-HYDROXYFLAVANONE
-
- $1.00
-
2019-07-06
- CAS:6515-36-2
- Min. Order: 1 mg
- Purity: 99%
- Supply Ability: 100KG
|
| | 7-HYDROXYFLAVANONE Basic information |
| Product Name: | 7-HYDROXYFLAVANONE | | Synonyms: | 7-HYDROXY-2-PHENYLCHROMAN-4-ONE;7-Hydroxyflavnone;7-Hydroxyflavanone,98%;HYDROXYFLAVANONE, 7-(RG);7-HYDROXYFLAVANONE 98%;7-Hydroxyflavanone,7-Hydroxy-2-phenylchroman-4-one;HYDROXYFLAVANONE, 7-;7-Hydroxyflavanone> | | CAS: | 6515-36-2 | | MF: | C15H12O3 | | MW: | 240.25 | | EINECS: | | | Product Categories: | Biochemistry;Flavonoids;Flavanones | | Mol File: | 6515-36-2.mol |  |
| | 7-HYDROXYFLAVANONE Chemical Properties |
| Melting point | 188-190 °C (lit.) | | Boiling point | 464.3±45.0 °C(Predicted) | | density | 1.288±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | form | Crystalline Powder | | pka | 7.69±0.40(Predicted) | | color | Pale yellow | | BRN | 87355 | | InChI | 1S/C15H12O3/c16-11-6-7-12-13(17)9-14(18-15(12)8-11)10-4-2-1-3-5-10/h1-8,14,16H,9H2 | | InChIKey | SWAJPHCXKPCPQZ-UHFFFAOYSA-N | | SMILES | Oc1ccc2C(=O)CC(Oc2c1)c3ccccc3 | | LogP | 3.490 (est) | | CAS DataBase Reference | 6515-36-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29329900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 7-HYDROXYFLAVANONE Usage And Synthesis |
| Chemical Properties | Pale yellow crystalline powder | | Uses | 7-Hydroxyflavanone has been used for the stereoisomeric separation of flavonoids using polysaccharide-based chiral stationary phases by nano-liquid chromatography (nano-LC). | | Definition | ChEBI: A monohydroxyflavanone that is flavanone substituted by a hydroxy group at position 7. | | IC 50 | Aromatase |
| | 7-HYDROXYFLAVANONE Preparation Products And Raw materials |
|