- Octinoxate
-
- $48.00 / 1g
-
2026-01-26
- CAS:5466-77-3
- Min. Order:
- Purity: 99.93%
- Supply Ability: 10g
- Octinoxate
-
- $48.00 / 1g
-
2026-01-26
- CAS:5466-77-3
- Min. Order:
- Purity: 99.93%
- Supply Ability: 10g
|
| | Octyl 4-methoxycinnamate Basic information |
| | Octyl 4-methoxycinnamate Chemical Properties |
| Melting point | <-25℃ | | Boiling point | 198-200°C | | density | 1.009 | | refractive index | 1.543-1.547 | | Fp | 193°C | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Liquid | | color | Clear colorless to yellow | | Odor | Odorless | | Water Solubility | <0.1 g/100 mL at 27 ºC | | BRN | 5946632 | | Stability: | Stable. Incompatible with strong oxidizing agents. | | Cosmetics Ingredients Functions | UV ABSORBER UV FILTER LIGHT STABILIZER | | InChI | 1S/C18H26O3/c1-4-6-7-15(5-2)14-21-18(19)13-10-16-8-11-17(20-3)12-9-16/h8-13,15H,4-7,14H2,1-3H3/b13-10+ | | InChIKey | YBGZDTIWKVFICR-JLHYYAGUSA-N | | SMILES | CCCCC(CC)COC(=O)\C=C\c1ccc(OC)cc1 | | LogP | 5.921 (est) | | CAS DataBase Reference | 5466-77-3(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Propenoic acid, 3-(4-methoxyphenyl)-, 2-ethylhexyl ester(5466-77-3) | | EPA Substance Registry System | 2-Ethylhexyl p-methoxycinnamate (5466-77-3) |
| Safety Statements | 24/25 | | WGK Germany | nwg | | RTECS | UD3392732 | | TSCA | TSCA listed | | HS Code | 29189090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Aquatic Chronic 4 | | Hazardous Substances Data | 5466-77-3(Hazardous Substances Data) |
| | Octyl 4-methoxycinnamate Usage And Synthesis |
| Chemical Properties | colourless or pale yellow liquid | | Uses | 2-Ethylhexyl 4-Methoxycinnamate is an UV induced cyclobutane pyrimidine dimer (CDP) formation inhibitior. | | Uses | octinoxate is the drug name for the sunscreen chemical generally known as octyl methoxycinnamate and ethylhexyl methoxycinnamate. | | Uses | 2-Ethylhexyl-4-methoxy-cinnamate is used as UV-B-absorbing agent in sunscreens and cosmetic creams, lotions, lipsticks, sun oils, etc. | | Definition | ChEBI: Octyl 4-methoxycinnamic acid is a cinnamate ester. | | Brand name | Parsol (Roche); Neo Heliopan (H & R Florasynth); Escalol (ISP Van Dyk) Note—The International Cosmetic Ingredient (INCI) name for octinoxate is octyl methoxycinnamate. | | General Description | Colorless to pale yellow viscous liquid. | | Air & Water Reactions | Insoluble in water. | | Fire Hazard | Flash point data for Octyl 4-methoxycinnamate are not available, however, Octyl 4-methoxycinnamate is probably combustible. |
| | Octyl 4-methoxycinnamate Preparation Products And Raw materials |
|