|
|
| | Isopropylhydrazine Hydrochloride Basic information |
| | Isopropylhydrazine Hydrochloride Chemical Properties |
| Melting point | 115-118 | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Water Solubility | Soluble in water | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C3H10N2.ClH/c1-3(2)5-4;/h3,5H,4H2,1-2H3;1H | | InChIKey | ILULYDJFTJKQAP-UHFFFAOYSA-N | | SMILES | C(C)(C)NN.Cl | | EPA Substance Registry System | Hydrazine, (1-methylethyl)-, monohydrochloride (16726-41-3) |
| Hazard Codes | Xi,T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN2811 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 2928009090 |
| | Isopropylhydrazine Hydrochloride Usage And Synthesis |
| Chemical Properties | White to almost white crystalline powder | | Uses | Potent monoamine oxidase inhibitor | | Preparation | Isopropylhydrazine hydrochloride is prepared by making hydrochloric acid hydrazine react with isopropanol under the protection of inert gas.
|
| | Isopropylhydrazine Hydrochloride Preparation Products And Raw materials |
|