|
|
| | (1R,3S)-4-CYCLOPENTENE-1,3-DIOL 1-ACETATE Basic information |
| Product Name: | (1R,3S)-4-CYCLOPENTENE-1,3-DIOL 1-ACETATE | | Synonyms: | (1R,4S)-4-hydroxycyclopent-2-enylacetate;(1S,4R)-cis-4-Acetoxy-2-cyclopenten-1-ol >=99%;(1R,4S)-4-hydroxycyclopent-2-en-1-yl acetate;(1R,4S)-4-Hydroxy-2-cyclopenten-1-yl Acetate;(1S,4R)-(+)-4-Acetoxy-2-cyclopentene-1-ol for synthesis;(1S,4R)-CIS-4-ACETOXY-2-CYCLOPENTEN-1-OL;(1R,4S)-CIS-4-HYDROXY-2-CYCLOPENTENYL ACETATE;(1R,3S)-(+)-CIS-4-CYCLOPENTENE-1,3-DIOL 1-ACETATE | | CAS: | 60410-16-4 | | MF: | C7H10O3 | | MW: | 142.15 | | EINECS: | | | Product Categories: | | | Mol File: | 60410-16-4.mol |  |
| | (1R,3S)-4-CYCLOPENTENE-1,3-DIOL 1-ACETATE Chemical Properties |
| Melting point | 49-52 °C | | Boiling point | 208.0±40.0 °C(Predicted) | | density | 1.17±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | form | Low Melting Solid | | pka | 14.11±0.40(Predicted) | | color | Off-white to beige | | Optical Rotation | [α]20/D +68°, c = 2.3 in chloroform | | BRN | 4663992 | | InChI | InChI=1S/C7H10O3/c1-5(8)10-7-3-2-6(9)4-7/h2-3,6-7,9H,4H2,1H3/t6-,7+/m1/s1 | | InChIKey | IJDYOKVVRXZCFD-RQJHMYQMSA-N | | SMILES | [C@H]1(OC(=O)C)C=C[C@@H](O)C1 |
| WGK Germany | 3 | | F | 10 | | HazardClass | IRRITANT | | HS Code | 29162000 |
| | (1R,3S)-4-CYCLOPENTENE-1,3-DIOL 1-ACETATE Usage And Synthesis |
| Chemical Properties | White to light yellow solid | | Uses | (1S,4R)-cis-4-Acetoxy-2-cyclopenten-1-ol can be used as:
- A building block for the synthesis of biologically significant carbocyclic nucleosides and prostaglandins.
- A starting material in the synthesis of azasugar analogs.
|
| | (1R,3S)-4-CYCLOPENTENE-1,3-DIOL 1-ACETATE Preparation Products And Raw materials |
|