- 2-(2-BIPHENYLYLOXY)ETHANOL
-
- $15.00 / 1KG
-
2021-07-13
- CAS:7501-02-2
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
- 2-(2-BIPHENYLYLOXY)ETHANOL
-
- $15.00 / 1KG
-
2021-07-10
- CAS:7501-02-2
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 2-(2-BIPHENYLYLOXY)ETHANOL Basic information |
| Product Name: | 2-(2-BIPHENYLYLOXY)ETHANOL | | Synonyms: | 2-(2-BIPHENYLYLOXY)ETHANOL;2-([1,1'-Biphenyl]-2-yloxy)ethanol;2-(2-Biphenyloxy)-ethanol;2-(o-biphenylyloxy)-ethano;2-(o-biphenylyloxy)-ethylalcoho;2-(o-phenyl)phenoxy-ethylalcoho;2-biphenyl-2-yloxy-ethanol;beta-Hydroxyethyl ether of o-phenylphenol | | CAS: | 7501-02-2 | | MF: | C14H14O2 | | MW: | 214.26 | | EINECS: | 231-355-1 | | Product Categories: | | | Mol File: | 7501-02-2.mol |  |
| | 2-(2-BIPHENYLYLOXY)ETHANOL Chemical Properties |
| Boiling point | 345℃ | | density | 1.111 | | Fp | 151℃ | | pka | 14.24±0.10(Predicted) | | InChI | InChI=1S/C14H14O2/c15-10-11-16-14-9-5-4-8-13(14)12-6-2-1-3-7-12/h1-9,15H,10-11H2 | | InChIKey | NOZAKUWNUGNDLI-UHFFFAOYSA-N | | SMILES | C(O)COC1=CC=CC=C1C1=CC=CC=C1 |
| | 2-(2-BIPHENYLYLOXY)ETHANOL Usage And Synthesis |
| | 2-(2-BIPHENYLYLOXY)ETHANOL Preparation Products And Raw materials |
|