| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | 7-(Piperidin-1-ylmethyl)quinolin-8-ol Basic information |
| Product Name: | 7-(Piperidin-1-ylmethyl)quinolin-8-ol | | Synonyms: | OTAVA-BB BB7010150234;AKOS BBS-00001111;AURORA 23227;7-(1-piperidinylmethyl)-8-hydroxyquinoline;8-Quinolinol, 7-(1-piperidinylmethyl)-;NSC57969 >=98% (HPLC);7-(Piperidin-1-ylmethyl)quinolin-8-ol | | CAS: | 6632-09-3 | | MF: | C15H18N2O | | MW: | 242.32 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 7-(Piperidin-1-ylmethyl)quinolin-8-ol Chemical Properties |
| Melting point | 194 °C | | Boiling point | 402.4±30.0 °C(Predicted) | | density | 1.202±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: 5mg/mL, clear (warmed) | | pka | 3.81±0.50(Predicted) | | form | powder | | color | white to beige | | InChI | 1S/C15H18N2O/c18-15-13(11-17-9-2-1-3-10-17)7-6-12-5-4-8-16-14(12)15/h4-8,18H,1-3,9-11H2 | | InChIKey | WXMFPLZGDXLEMN-UHFFFAOYSA-N | | SMILES | OC1=C(N=CC=C2)C2=CC=C1CN3CCCCC3 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 7-(Piperidin-1-ylmethyl)quinolin-8-ol Usage And Synthesis |
| Uses | NSC-57969 is a multidrug resistant (MDR)-selective agent, exhibiting a robust Pgp-dependent toxic activity across diverse cancer cell lines[1]. | | Biological Activity | NSC57969 is a MDR-selective compound th at exhibits a robust Pgp-dependent toxic activity across diverse cancer cell lines. NSC57969 shows profound toxicity against doxorubicin resistant Brca1-/-;p53-/- spontaneous mouse mammary carcinoma cells. NSC57969 eradicates P-glycoprotein expression in doxorubicin resistant brca1-/-;p53-/- spontaneous mouse mammary carcinoma, and MES-SA/Dx5 cells. However treatment of normal cells (hCMEC/D3 cells) with NSC57969 does not induce loss of Pgp. | | References | [1] András Füredi, et al. Identification and Validation of Compounds Selectively Killing Resistant Cancer: Delineating Cell Line-Specific Effects from P-Glycoprotein-Induced Toxicity. Mol Cancer Ther. 2017 Jan;16(1):45-56. DOI:10.1158/1535-7163.MCT-16-0333-T |
| | 7-(Piperidin-1-ylmethyl)quinolin-8-ol Preparation Products And Raw materials |
|