| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-Methoxy-6,7,8,9-tetrahydrobenzocyclohepten-5-one Basic information |
| Product Name: | 2-Methoxy-6,7,8,9-tetrahydrobenzocyclohepten-5-one | | Synonyms: | 2-METHOXY-6,7,8,9-TETRAHYDRO-BENZOCYCLOHEPTEN-5-ONE;2-Methoxy-6,7,8,9-tetrohydro-benzocyclohepten-5-one;2-Methoxy-6,7,8,9-tetrahydro-benzocyclohepten-5-;2-Methoxy-6,7,8,9-tetrahydro-5H-cyclobenzoheptan-5-one;5H-Benzocyclohepten-5-one, 6,7,8,9-tetrahydro-2-methoxy-;2-Methoxy-6,7,8,9-Tetrahydrobenzo[7]Annulen-5-One;2-Methoxy-6,7,8,9-tetrahydro-benzocyclohepten-5-one, CAS 6500-65-8;2-methoxybenzenebenzocycloheptyl-5-one | | CAS: | 6500-65-8 | | MF: | C12H14O2 | | MW: | 190.24 | | EINECS: | | | Product Categories: | | | Mol File: | 6500-65-8.mol |  |
| | 2-Methoxy-6,7,8,9-tetrahydrobenzocyclohepten-5-one Chemical Properties |
| Melting point | 54-56 °C | | Boiling point | 118-122 °C(Press: 0.5 Torr) | | density | 1.090±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | color | white | | InChI | InChI=1S/C12H14O2/c1-14-10-6-7-11-9(8-10)4-2-3-5-12(11)13/h6-8H,2-5H2,1H3 | | InChIKey | WLRMIOGKWITDNU-UHFFFAOYSA-N | | SMILES | C12=CC=C(OC)C=C1CCCCC2=O |
| Hazard Codes | Xn | | Risk Statements | 22 | | HS Code | 2914500090 |
| | 2-Methoxy-6,7,8,9-tetrahydrobenzocyclohepten-5-one Usage And Synthesis |
| | 2-Methoxy-6,7,8,9-tetrahydrobenzocyclohepten-5-one Preparation Products And Raw materials |
| Raw materials | 5H-Benzocyclohepten-5-amine, 6,7,8,9-tetrahydro-2-methoxy--->1,3-Benzodithiole, 2-[4-(3-methoxyphenyl)butyl]-2-[2-(trimethylsilyl)ethoxy]-, 1,1,3,3-tetraoxide-->5H-Benzocycloheptene, 6,7,8,9-tetrahydro-2-methoxy--->5-(3-Methoxy-phenyl)-penta-2,4-dienoic acid-->5-(m-Methoxyphenyl)valeric acid-->(3-Carboxypropyl)triphenylphosphonium bromide-->6-methoxy-1-tetralone |
|