|
|
| | TRIBUTYLPHENYLTIN Basic information |
| | TRIBUTYLPHENYLTIN Chemical Properties |
| Melting point | <0°C | | Boiling point | 125-128 °C/0.14 mmHg (lit.) | | density | 1.125 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.516(lit.) | | Fp | >230 °F | | storage temp. | Storage temp. -20°C | | solubility | Sparingly Soluble (9.9E-5 g/L) (25°C) | | form | Oil | | Specific Gravity | 1.125 | | color | Colourless to Light Yellow | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | BRN | 3610571 | | Stability: | Moisture Sensitive | | InChI | 1S/C6H5.3C4H9.Sn/c1-2-4-6-5-3-1;3*1-3-4-2;/h1-5H;3*1,3-4H2,2H3; | | InChIKey | SYUVAXDZVWPKSI-UHFFFAOYSA-N | | SMILES | CCCC[Sn](CCCC)(CCCC)c1ccccc1 |
| Hazard Codes | T,N | | Risk Statements | 21-25-36/38-48/23/25-50/53 | | Safety Statements | 35-36/37/39-45-60-61 | | RIDADR | UN 2788 6.1/PG 3 | | WGK Germany | 3 | | TSCA | No | | HazardClass | 6.1(a) | | PackingGroup | II | | HS Code | 29319090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Acute Tox. 4 Dermal
Aquatic Acute 1
Aquatic Chronic 1
Eye Irrit. 2
Repr. 1B
Skin Irrit. 2
STOT RE 1 |
| | TRIBUTYLPHENYLTIN Usage And Synthesis |
| Chemical Properties | Clear colorless liquid | | Uses | It is applied in chemical research. |
| | TRIBUTYLPHENYLTIN Preparation Products And Raw materials |
|