3-PHENYL-CYCLOHEXANONE manufacturers
- 3-PHENYL-CYCLOHEXANONE
-
- $0.01 / 1KG
-
2020-01-10
- CAS:20795-53-3
- Min. Order: 1KG
- Purity: 98%; 99%
- Supply Ability: 500g;1kg; 25kg
|
| | 3-PHENYL-CYCLOHEXANONE Basic information |
| | 3-PHENYL-CYCLOHEXANONE Chemical Properties |
| Melting point | 64 °C | | Boiling point | 287-288 °C(Press: 736 Torr) | | density | 1.042±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | form | Oil | | color | Pale Yellow to Yellow | | InChI | InChI=1S/C12H14O/c13-12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-3,5-6,11H,4,7-9H2 | | InChIKey | CJAUDSQXFVZPTO-UHFFFAOYSA-N | | SMILES | C1(=O)CCCC(C2=CC=CC=C2)C1 |
| HazardClass | IRRITANT | | HS Code | 2914390090 |
| | 3-PHENYL-CYCLOHEXANONE Usage And Synthesis |
| Uses | 3-Phenylcyclohexanone is used in preparation of cyclic Ketone derivatives via ring expansion reaction of beta-selenyl cyclic Ketone derivatives. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 51, p. 4953, 1986 DOI: 10.1021/jo00375a037 Tetrahedron Letters, 42, p. 781, 2001 DOI: 10.1016/S0040-4039(00)02176-6 |
| | 3-PHENYL-CYCLOHEXANONE Preparation Products And Raw materials |
|