|
|
| | 1-(4-Fluorophenyl)-5-methylimidazolidine-2,4-dione Basic information |
| | 1-(4-Fluorophenyl)-5-methylimidazolidine-2,4-dione Chemical Properties |
| form | solid | | InChI | 1S/C10H9FN2O2/c1-6-9(14)12-10(15)13(6)8-4-2-7(11)3-5-8/h2-6H,1H3,(H,12,14,15) | | InChIKey | ROVJZYRAYUJYKN-UHFFFAOYSA-N | | SMILES | CC1N(C(=O)NC1=O)c2ccc(F)cc2 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 1-(4-Fluorophenyl)-5-methylimidazolidine-2,4-dione Usage And Synthesis |
| | 1-(4-Fluorophenyl)-5-methylimidazolidine-2,4-dione Preparation Products And Raw materials |
|