|
|
| | 2,6-Dibromo-4-methylaniline Basic information |
| Product Name: | 2,6-Dibromo-4-methylaniline | | Synonyms: | 2,6-Dibromo-p-toluidine (NH2=1);2,6-Dibromo-p-toludine;Benzenamine, 2,6-dibromo-4-methyl-;2,6-Dibromo-4-methylbenzenamine;2 6-DIBROMO-4-METHYLANILINE 98% (GC);2,6-Dibromo-4-methylaniline, 98+%;TIMTEC-BB SBB007582;2,6-DIBROMO-P-TOLUIDINE | | CAS: | 6968-24-7 | | MF: | C7H7Br2N | | MW: | 264.95 | | EINECS: | 230-182-9 | | Product Categories: | Intermediates of Dyes and Pigments;API intermediates;Anilines, Amides & Amines;Bromine Compounds | | Mol File: | 6968-24-7.mol |  |
| | 2,6-Dibromo-4-methylaniline Chemical Properties |
| Melting point | 74-76 °C(lit.) | | Boiling point | 283.3±35.0 °C(Predicted) | | density | 1.8413 (rough estimate) | | refractive index | 1.6300 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,2-8°C | | pka | 0.91±0.10(Predicted) | | form | Powder | | color | Light brown | | Water Solubility | Insoluble in water. | | BRN | 2085782 | | InChI | InChI=1S/C7H7Br2N/c1-4-2-5(8)7(10)6(9)3-4/h2-3H,10H2,1H3 | | InChIKey | ATDIROHVRVQMRO-UHFFFAOYSA-N | | SMILES | C1(N)=C(Br)C=C(C)C=C1Br | | CAS DataBase Reference | 6968-24-7(CAS DataBase Reference) | | NIST Chemistry Reference | 2,6-Dibromo-4-methylaniline(6968-24-7) |
| | 2,6-Dibromo-4-methylaniline Usage And Synthesis |
| Chemical Properties | light brown powder | | Uses | 2,6-Dibromo-4-methylaniline is used as coupling reagent in spectrophotometric determination of carbaryl in various environmental samples. It was also in preparation of 2-bromo-6-iodo-4-methylaniline. 2,6-Dibromo-4-methylaniline undergoes Suzuki-coupling reaction with 2-dihydroxyboryl-3-methyl-2-cyclopenten-1-one during synthesis of the dinuclear dichlorotitanium complexes. 2,6-Dibromo-4-methylaniline is also used as an intermediate for the synthesis of pharmaceutucals, agrochemicals, dyes and other organic chemicals. |
| | 2,6-Dibromo-4-methylaniline Preparation Products And Raw materials |
|