| Company Name: |
Beijing Fuchen Technology Co., Ltd Gold
|
| Tel: |
15652759959 |
| Email: |
623245911@qq.com |
| Products Intro: |
Product Name:6-(3,4-dimethoxyphenyl)-2-[(3-fluorophenyl)methyl]pyridazin-3-one
CAS:899946-56-6
Purity:大于95%HPLC Package:可分装，多个包装
|
| Company Name: |
Beijing Yisiyan Technology Research Center
|
| Tel: |
010-56645598 13366904824; |
| Email: |
bjkaida@163.com |
| Products Intro: |
Product Name:6-(3,4-dimethoxyphenyl)-2-[(3-fluorophenyl)methyl]pyridazin-3-one
CAS:899946-56-6
Package:1g/;5g/;10g/
|
| Company Name: |
Aikon International Limited
|
| Tel: |
025-66113011 19370895928 |
| Email: |
qzhang@aikonchem.com |
| Products Intro: |
Product Name:3(2H)-Pyridazinone, 6-(3,4-dimethoxyphenyl)-2-[(3-fluorophenyl)methyl]-
CAS:899946-56-6
Purity:95+% Package:1g;5g;10g
|
| Company Name: |
Shanghai Kaiwei Chemical Technology Co., Ltd.
|
| Tel: |
021-58461859 15821823057 |
| Email: |
service@aiviche.com |
| Products Intro: |
Product Name:3(2H)-Pyridazinone, 6-(3,4-dimethoxyphenyl)-2-[(3-fluorophenyl)methyl]-
CAS:899946-56-6
Purity:97% Package:1g;1kg
|
| Company Name: |
Hubei Xinyang Medical Technology Co., Ltd
|
| Tel: |
15347293736 |
| Email: |
2853117764@yongstandards.com |
| Products Intro: |
Product Name:6-(3,4-dimethoxyphenyl)-2-[(3-fluorophenyl)methyl]pyridazin-3-one
CAS:899946-56-6
Purity:99% HPLC Package:10mg;25mg;50mg;100mg;200mg;500mg
|
|
| | 6-(3,4-dimethoxyphenyl)-2-[(3-fluorophenyl)methyl]pyridazin-3-one Basic information |
| | 6-(3,4-dimethoxyphenyl)-2-[(3-fluorophenyl)methyl]pyridazin-3-one Chemical Properties |
| Boiling point | 479.1±55.0 °C(Predicted) | | density | 1.21±0.1 g/cm3(Predicted) | | pka | -1.18±0.70(Predicted) | | InChI | InChI=1S/C19H17FN2O3/c1-24-17-8-6-14(11-18(17)25-2)16-7-9-19(23)22(21-16)12-13-4-3-5-15(20)10-13/h3-11H,12H2,1-2H3 | | InChIKey | LWTVHLFRKFPCAS-UHFFFAOYSA-N | | SMILES | C1(=O)N(CC2=CC=CC(F)=C2)N=C(C2=CC=C(OC)C(OC)=C2)C=C1 |
| | 6-(3,4-dimethoxyphenyl)-2-[(3-fluorophenyl)methyl]pyridazin-3-one Usage And Synthesis |
| | 6-(3,4-dimethoxyphenyl)-2-[(3-fluorophenyl)methyl]pyridazin-3-one Preparation Products And Raw materials |
|