|
|
| | Perfluoro-1-octanesulfonyl fluoride Basic information |
| Product Name: | Perfluoro-1-octanesulfonyl fluoride | | Synonyms: | PERFLUORO-1-OCTANESULFONYL FLUORIDE;PERFLUOROOCTANESULFONYL FLUORIDE;PERFLUOROOCTANESULPHONYL FLUORIDE;PERFLUOROOCTYL SULFONYL CHLORIDE;PERFLUORO-N-OCTANESULFONYL FLUORIDE;FX-8;Perfluorooctanesulfonylfluoride-RM90;1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Heptadecafluoro-1-octanesulfonyl fluoride | | CAS: | 307-35-7 | | MF: | C8F18O2S | | MW: | 502.12 | | EINECS: | 206-200-6 | | Product Categories: | Building Blocks;Chemical Synthesis;Fluorinated Building Blocks;F-Tagged;Organic Building Blocks;Organic Fluorinated Building Blocks;Sulfonyl Fluorides;Sulfonyl Halides;Sulfur Compounds;Fluorous Chemistry;Fluorous Compounds;Synthetic Organic Chemistry;organofluorine compounds | | Mol File: | 307-35-7.mol |  |
| | Perfluoro-1-octanesulfonyl fluoride Chemical Properties |
| Melting point | -1 °C | | Boiling point | 154-155 °C(lit.) | | density | 1.824 g/mL at 25 °C(lit.) | | vapor density | >1 (vs air) | | vapor pressure | <10 mm Hg ( 20 °C) | | refractive index | n20/D 1.301 | | Fp | >100°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | liquid | | color | colorless to yellow | | Specific Gravity | 1.81 | | Sensitive | Moisture Sensitive | | BRN | 1718067 | | Stability: | Hygroscopic, Moisture Sensitive | | InChI | 1S/C8F18O2S/c9-1(10,3(13,14)5(17,18)7(21,22)23)2(11,12)4(15,16)6(19,20)8(24,25)29(26,27)28 | | InChIKey | BHFJBHMTEDLICO-UHFFFAOYSA-N | | SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)S(F)(=O)=O | | CAS DataBase Reference | 307-35-7(CAS DataBase Reference) | | NIST Chemistry Reference | Perfluoro-1-octanesulfonyl fluoride(307-35-7) | | EPA Substance Registry System | Perfluorooctylsulfonyl fluoride (307-35-7) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45-25 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 3 | | F | 10-21 | | Hazard Note | Corrosive | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29041000 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Aquatic Chronic 2
Carc. 2
Lact.
Repr. 1B
STOT RE 1 | | Hazardous Substances Data | 307-35-7(Hazardous Substances Data) |
| | Perfluoro-1-octanesulfonyl fluoride Usage And Synthesis |
| Chemical Properties | clear colourless liquid | | Uses | Perfluorooctylsulfonyl Fluoride is commonly used as a surfactant for coatings such as papers and board coatings. As well, it can be commonly found to be used as a catalyst. | | Definition | ChEBI: Perfluorooctylsulfonyl fluoride is a sulfonic acid derivative. | | reaction suitability | reaction type: click chemistry |
| | Perfluoro-1-octanesulfonyl fluoride Preparation Products And Raw materials |
|