|
|
| | Pyr-Val-OH Basic information |
| Product Name: | Pyr-Val-OH | | Synonyms: | Pyr-Val-OH | | CAS: | | | MF: | C10H16N2O4 | | MW: | 228.25 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | Pyr-Val-OH Chemical Properties |
| storage temp. | -15°C | | form | solid | | InChI | 1S/C10H16N2O4/c1-5(2)8(10(15)16)12-9(14)6-3-4-7(13)11-6/h5-6,8H,3-4H2,1-2H3,(H,11,13)(H,12,14)(H,15,16)/t6-,8-/m0/s1 | | InChIKey | DTSWLLBBGHRXQH-XPUUQOCRSA-N | | SMILES | CC(C)[C@H](NC(=O)[C@@H]1CCC(=O)N1)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Pyr-Val-OH Usage And Synthesis |
| | Pyr-Val-OH Preparation Products And Raw materials |
|