| Company Name: |
Labex Corporation |
| Tel: |
+91-11-26135922 or +91-11-46160359 |
| Email: |
labex@labex.net |
- 1-PHENYL-2-PENTANONE
-
- $1.00
-
2020-01-10
- CAS:6683-92-7
- Min. Order: 1g
- Purity: 99.0%
- Supply Ability: 100kg
|
| | 1-Phenyl-2-pentanone Basic information |
| | 1-Phenyl-2-pentanone Chemical Properties |
| Boiling point | 237-239 °C | | density | 0.9889 g/cm3(Temp: 12 °C) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Sparingly), Methanol (Sparingly) | | form | Oil | | color | Colourless | | InChI | InChI=1S/C11H14O/c1-2-6-11(12)9-10-7-4-3-5-8-10/h3-5,7-8H,2,6,9H2,1H3 | | InChIKey | NFKAWBGFIMBUMB-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC=C1)C(=O)CCC |
| | 1-Phenyl-2-pentanone Usage And Synthesis |
| Uses | 1-Phenyl-2-pentanone is an aryl ketone that may be a useful repellent in pesticides toxic to honeybees. | | Synthesis Reference(s) | Chemistry Letters, 6, p. 1021, 1977 Tetrahedron, 49, p. 7104, 1993 DOI: 10.1016/S0040-4020(01)87982-5 |
| | 1-Phenyl-2-pentanone Preparation Products And Raw materials |
|