|
|
| | 4-TRIMETHYLSILOXY-3-PENTEN-2-ONE Basic information |
| | 4-TRIMETHYLSILOXY-3-PENTEN-2-ONE Chemical Properties |
| Boiling point | 66-68 °C4 mm Hg(lit.) | | density | 0.912 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.452(lit.) | | Fp | 58°C | | storage temp. | 2-8°C | | Specific Gravity | 0.912 | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | BRN | 1759078 | | InChI | 1S/C8H16O2Si/c1-7(9)6-8(2)10-11(3,4)5/h6H,1-5H3/b8-6+ | | InChIKey | FBADCSUQBLLAHW-SOFGYWHQSA-N | | SMILES | CC(=O)\C=C(/C)O[Si](C)(C)C | | CAS DataBase Reference | 13257-81-3(CAS DataBase Reference) | | EPA Substance Registry System | 3-Penten-2-one, 4-[(trimethylsilyl)oxy]- (13257-81-3) |
| Hazard Codes | Xi | | Risk Statements | 10-36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN 1224 3/PG 3 | | WGK Germany | 3 | | F | 10-21 | | TSCA | TSCA listed | | HazardClass | 3.2 | | PackingGroup | III | | HS Code | 29319090 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| | 4-TRIMETHYLSILOXY-3-PENTEN-2-ONE Usage And Synthesis |
| Uses | 4-(Trimethylsiloxy)-3-penten-2-one (trimethylsilyl ether of acetylacetone) has been used in the synthesis of isomers of organosilicon carbofunctional compounds:
- 4-(3μ-triethoxysilylpropylimino)pent-2-en-2-ol
- 4-(3μ-triethoxysilylpropylamino)pent-3-en-2-one
|
| | 4-TRIMETHYLSILOXY-3-PENTEN-2-ONE Preparation Products And Raw materials |
|