PROPARGYL ACETATE manufacturers
- PROPARGYL ACETATE
-
- $1.00 / 1g
-
2019-12-26
- CAS:627-09-8
- Min. Order: 1g
- Purity: ≥98%
- Supply Ability: g/kg/Ton
|
| | PROPARGYL ACETATE Basic information |
| | PROPARGYL ACETATE Chemical Properties |
| Boiling point | 27-28 °C(lit.) | | density | 0.989 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.417(lit.) | | Fp | 91 °F | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | form | Liquid | | color | Clear colorless | | BRN | 1742046 | | InChI | InChI=1S/C5H6O2/c1-3-4-7-5(2)6/h1H,4H2,2H3 | | InChIKey | RIZZXCJMFIGMON-UHFFFAOYSA-N | | SMILES | C(OC(=O)C)C#C | | CAS DataBase Reference | 627-09-8 |
| Hazard Codes | Xn | | Risk Statements | 10-20/21/22 | | Safety Statements | 16-23-36/37 | | RIDADR | UN 1992 3/PG 3 | | WGK Germany | 3 | | RTECS | UK5076000 | | HazardClass | 3 | | PackingGroup | II | | HS Code | 29153900 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Oral
Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Flam. Liq. 3 |
| | PROPARGYL ACETATE Usage And Synthesis |
| Chemical Properties | Clear colorless liquid | | Uses | Propargyl acetate may be used to synthesize:
- optically active γ-hydroxy α,β-unsaturated aldehydes
- homopropargyl alcohols
- poly(propargyl acetate)
|
| | PROPARGYL ACETATE Preparation Products And Raw materials |
|