|
|
| | Linezolid Impurity 34 Basic information |
| Product Name: | Linezolid Impurity 34 | | Synonyms: | Linezolid Impurity 42;Linezolid Impurity 34;4-(2-Fluoro-5-nitrophenyl)morpholine;4-(2-Fluoro-5-nitrophenyl)morpholine(Linezolid Impurity);Morpholine, 4-(2-fluoro-5-nitrophenyl)-;Linezolid Impurity 40/4-(2-Fluoro-5-nitrophenyl)morpholine | | CAS: | 1233093-70-3 | | MF: | C10H11FN2O3 | | MW: | 226.2 | | EINECS: | | | Product Categories: | | | Mol File: | 1233093-70-3.mol |  |
| | Linezolid Impurity 34 Chemical Properties |
| Boiling point | 362.9±42.0 °C(Predicted) | | density | 1.340±0.06 g/cm3(Predicted) | | pka | 2.54±0.40(Predicted) | | InChI | InChI=1S/C10H11FN2O3/c11-9-2-1-8(13(14)15)7-10(9)12-3-5-16-6-4-12/h1-2,7H,3-6H2 | | InChIKey | QAGRLLGFZROGAS-UHFFFAOYSA-N | | SMILES | N1(C2=CC([N+]([O-])=O)=CC=C2F)CCOCC1 |
| | Linezolid Impurity 34 Usage And Synthesis |
| | Linezolid Impurity 34 Preparation Products And Raw materials |
|