|
|
| | 2,4,6-Tris(4-ethynylphenyl)-1,3,5-triazine Basic information |
| Product Name: | 2,4,6-Tris(4-ethynylphenyl)-1,3,5-triazine | | Synonyms: | 2,4,6-tri[(4-ethynyl)phenyl]-1,3,5-triazine;2,4,6-Tris(4-ethynylphenyl)-1,3,5-triazine;[1,3,5-Triazine, 2,4,6-tris(4-ethynylphenyl)-] | | CAS: | 425629-22-7 | | MF: | C27H15N3 | | MW: | 381.43 | | EINECS: | | | Product Categories: | | | Mol File: | 425629-22-7.mol |  |
| | 2,4,6-Tris(4-ethynylphenyl)-1,3,5-triazine Chemical Properties |
| Boiling point | 593.6±60.0 °C(Predicted) | | density | 1.28±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | pka | 0.02±0.10(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C27H15N3/c1-4-19-7-13-22(14-8-19)25-28-26(23-15-9-20(5-2)10-16-23)30-27(29-25)24-17-11-21(6-3)12-18-24/h1-3,7-18H | | InChIKey | SSAOTGYMADTRMZ-UHFFFAOYSA-N | | SMILES | N1=C(C2=CC=C(C#C)C=C2)N=C(C2=CC=C(C#C)C=C2)N=C1C1=CC=C(C#C)C=C1 |
| | 2,4,6-Tris(4-ethynylphenyl)-1,3,5-triazine Usage And Synthesis |
| | 2,4,6-Tris(4-ethynylphenyl)-1,3,5-triazine Preparation Products And Raw materials |
|