Gefitinib-based PROTAC 3 manufacturers
|
| | Gefitinib-based PROTAC 3 Basic information |
| Product Name: | Gefitinib-based PROTAC 3 | | Synonyms: | Gefitinib-based PROTAC 3;NTN21277;NTN21277(Gefitinib-based PROTAC 3);Gefitinib-PROTAC-3;Gefitinib-based PROTAC 3,Epidermal growth factor receptor,inhibit,Inhibitor,Gefitinib based PROTAC 3,HER1,PROTACs,ErbB-1,Gefitinibbased PROTAC 3,EGFR;(2S,4R)-1-((S)-2-(3-(2-((5-((4-((3-chloro-4-fluorophenyl)amino)-7-methoxyquinazolin-6-yl)oxy)pentyl)oxy)ethoxy)propanamido)-3,3-dimethylbutanoyl)-4-hydroxy-N-(4-(4-methylthiazol-5-yl)benzyl)pyrrolidine-2-carboxamide | | CAS: | 2230821-27-7 | | MF: | C47H57ClFN7O8S | | MW: | 934.52 | | EINECS: | | | Product Categories: | | | Mol File: | 2230821-27-7.mol |  |
| | Gefitinib-based PROTAC 3 Chemical Properties |
| Boiling point | 1065.6±65.0 °C(Predicted) | | density | 1.300±0.06 g/cm3(Predicted) | | storage temp. | 4°C, away from moisture and light | | solubility | DMF: 25 mg/ml; DMF:PBS (pH 7.2) (1:3): 0.25 mg/ml; DMSO: 16 mg/ml; Ethanol: 10 mg/ml | | pka | 14.07±0.40(Predicted) | | form | A crystalline solid | | color | Off-white to light yellow | | InChIKey | NICKHWYZMNLEPJ-OMWXADOMNA-N | | SMILES | N(C1C=CC(F)=C(Cl)C=1)C1=NC=NC2C=C(OC)C(OCCCCCOCCOCCC(=O)N[C@@H](C(C)(C)C)C(N3C[C@H](O)C[C@H]3C(=O)NCC3C=CC(C4=C(N=CS4)C)=CC=3)=O)=CC1=2 |&1:34,42,45,r| |
| | Gefitinib-based PROTAC 3 Usage And Synthesis |
| Description | Gefitinib-based PROTAC 3 contains an EGFR binding element and a von Hippel-Lindau ligand joined by a linker which induces EGFR degradation. | | Uses | Gefitinib-based PROTAC 3 is useful for EGFR proteolysis targeting. | | IC 50 | EGFR: 11.7 nM (DC50, HCC827(exon 19 del) cells); EGFR: 22.3 nM (DC50, H3255 (L858R mutantion) cells); PROTAC | | storage | Store at -20°C |
| | Gefitinib-based PROTAC 3 Preparation Products And Raw materials |
|