| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:TAPI-0
CAS:163958-73-4
Purity:>=95% (HPLC) Package:1mg Remarks:SML1292
|
| Company Name: |
Hangzhou Peptidego Biotech Co.,Ltd.
|
| Tel: |
0571-87213919 15967184799 |
| Email: |
Eric@peptidego.com |
| Products Intro: |
Product Name:TAPI-0
CAS:163958-73-4
Purity:95% or 98% HPLC Package:1mg；5mg；10mg；50mg；100mg,1g or according to customer's detail requirement.
|
| Company Name: |
Shanghai Hongye Biotechnology Co. Ltd
|
| Tel: |
400-9205774 400-920-5774 |
| Email: |
sales@glpbio.cn |
| Products Intro: |
Product Name:TAPI 0
CAS:163958-73-4
Purity:>98% Package:1mg;10mg;50mg;100mg;
|
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
| Products Intro: |
Product Name:TAPI 0
CAS:163958-73-4
Purity:≥95% by HPLC Remarks:TAPI 0 is an ADAM-17 (TACE) and matrix metalloprotease (MMP) inhibitor. TAPI 0 can inhibit spontaneous and PMA-induced TNF α release and processing.
|
|
| Product Name: | TAPI-0 | | Synonyms: | N-[(2R)-2-[2-(Hydroxyamino)-2-oxoethyl]-4-methyl-1-oxopentyl]-3-(2-naphthalenyl)-L-alanyl-L-alaninamide;L-Alaninamide, N-[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]-4-methyl-1-oxopentyl]-3-(2-naphthalenyl)-L-alanyl-;TAPI-0 >=95% (HPLC);TAPI | | CAS: | 163958-73-4 | | MF: | C24H32N4O5 | | MW: | 456.54 | | EINECS: | | | Product Categories: | | | Mol File: | 163958-73-4.mol |  |
| | TAPI-0 Chemical Properties |
| density | 1.227±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Soluble in DMSO | | form | powder | | pka | 9.17±0.20(Predicted) | | color | white to off-white | | InChIKey | WSJJYJNVFYARGB-CVAIRZPRSA-N | | SMILES | NC([C@@](C)([H])NC([C@]([H])(CC1=CC=CC2=C1C=CC=C2)NC([C@@](CC(C)C)([H])CC(NO)=O)=O)=O)=O |
| RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | TAPI-0 Usage And Synthesis |
| Uses | TAPI 0 is a metalloprotease inhibitor, which inhibits the obligate intracellular human pathogen Chalmydia trachomitis. | | Biochem/physiol Actions | TAPI-0 is a metalloproteinase inhibitor with selectivity for TACE (TNF-α converting enzyme/ADAM17; IC50 = 100 nM). TAPI-0 also inhibits of collagenase and gelatinase. Although not specific for TACE, TAPI-0 is extensively used to block TACE-mediated TNF-α shedding. | | storage | Store at -20°C |
| | TAPI-0 Preparation Products And Raw materials |
|