|
| 4-METHYLIMIDAZOLIDINE-2-THIONE Basic information |
| 4-METHYLIMIDAZOLIDINE-2-THIONE Chemical Properties |
Melting point | 102-104 °C | Boiling point | 157.3±23.0 °C(Predicted) | density | 1.095 (estimate) | refractive index | 1.5000 (estimate) | storage temp. | Refrigerator | solubility | Chloroform (Sparingly, Sonicated), Methanol (Slightly) | pka | 15.35±0.40(Predicted) | color | White to Beige | InChI | InChI=1S/C4H8N2S/c1-3-2-5-4(7)6-3/h3H,2H2,1H3,(H2,5,6,7) | InChIKey | NGZJXCFNBVJLQN-UHFFFAOYSA-N | SMILES | C1(=S)NCC(C)N1 | EPA Substance Registry System | 2-Imidazolidinethione, 4-methyl- (2122-19-2) |
| 4-METHYLIMIDAZOLIDINE-2-THIONE Usage And Synthesis |
Uses | 4-METHYLIMIDAZOLIDINE-2-THIONE is an intermediate used in various organic chemical reactions such as the preparation of aryl 2-Iminoimidazoline derivatives. | Uses | N,N''-(1,2-Propylene)thiourea is an intermediate used in various organic chemical reactions such as the preparation of aryl 2-Iminoimidazoline derivatives. |
| 4-METHYLIMIDAZOLIDINE-2-THIONE Preparation Products And Raw materials |
|