Methyl 2-methoxy-5-(ethylsulfonyl)benzoate manufacturers
|
| | Methyl 2-methoxy-5-(ethylsulfonyl)benzoate Basic information |
| Product Name: | Methyl 2-methoxy-5-(ethylsulfonyl)benzoate | | Synonyms: | 2-METHOXY-5-ETHYSULFONYLBENZOIC ACID METHYL ESTER;methyl 5-(ethylsulphonyl)-o-anisate;2-methoxyl-5-ethylsulfonyl methyl benzoate;Methyl 2-Methoxyl-5-Ethylsulfonyl-Benzoate;METHYL 5-ETHYLSULFONYL-2-METHOXY-BENZOATE;METHYL 2-METHOXY-5-(ETHYLSULFONYL)BENZOATE;2-Methoxy-5-Ethylsulfonyl;5-(Ethylsulfonyl)-o-anisic acid methyl ester | | CAS: | 62140-67-4 | | MF: | C11H14O5S | | MW: | 258.29 | | EINECS: | 263-429-4 | | Product Categories: | | | Mol File: | 62140-67-4.mol |  |
| | Methyl 2-methoxy-5-(ethylsulfonyl)benzoate Chemical Properties |
| Melting point | 126 °C | | storage temp. | 2-8°C | | form | powder to crystal | | color | White to Almost white | | InChI | 1S/C11H14O5S/c1-4-17(13,14)8-5-6-10(15-2)9(7-8)11(12)16-3/h5-7H,4H2,1-3H3 | | InChIKey | UUARTHQJSZTOEM-UHFFFAOYSA-N | | SMILES | O=C(OC)C1=C(OC)C=CC(S(CC)(=O)=O)=C1 | | CAS DataBase Reference | 62140-67-4(CAS DataBase Reference) |
| WGK Germany | WGK 3 | | HS Code | 2918999090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Methyl 2-methoxy-5-(ethylsulfonyl)benzoate Usage And Synthesis |
| | Methyl 2-methoxy-5-(ethylsulfonyl)benzoate Preparation Products And Raw materials |
|