|
|
| | 3-(METHACRYLOYLOXY)PROPYLTRIS(TRIMETHYLSILOXY)SILANE Basic information |
| Product Name: | 3-(METHACRYLOYLOXY)PROPYLTRIS(TRIMETHYLSILOXY)SILANE | | Synonyms: | Methacrylic acid 4,4-bis(trimethylsilyloxy)-6,6-dimethyl-5-oxa-4,6-disilaheptane-1-yl ester;Methacrylic acid=3-[tris(trimethylsiloxy)silyl]propyl ester;3-Methacryloyloxypropyltris(trimethylsilyloxy)silane,98%;3-(Methacryloyloxy)propyltris(trimethylsilyloxy)silane
Methacrylic Acid 3-[Tris(trimethylsilyloxy)silyl]propyl Ester;Tris(triMethylsiloxy)silyl]propyl Methacry;3-(1,1,1,5,5,5-HexaMethyl-3-((triMethylsilyl)oxy)trisiloxan-3-yl)propyl Methacrylate;2-Propenoic acid,2-Methyl-, 3-[3,3,3-triMethyl-1,1-bis[(triMethylsilyl)oxy]-1-disiloxanyl]propylester;Tris(trimethylsiloxy)silylpropylmethacrylate | | CAS: | 17096-07-0 | | MF: | C16H38O5Si4 | | MW: | 422.81 | | EINECS: | 241-165-0 | | Product Categories: | Methacrylate Silanes;monomer;Si (Classes of Silicon Compounds);Si-O Compounds;Trialkoxysilanes | | Mol File: | 17096-07-0.mol |  |
| | 3-(METHACRYLOYLOXY)PROPYLTRIS(TRIMETHYLSILOXY)SILANE Chemical Properties |
| Melting point | <0°C | | Boiling point | 112-115 °C0.2 mm Hg(lit.) | | density | 0.918 g/mL at 25 °C(lit.) | | vapor pressure | <1 mm Hg ( 20 °C) | | refractive index | n20/D 1.419(lit.) | | Fp | >230 °F | | storage temp. | Inert atmosphere,2-8°C | | form | clear liquid | | Specific Gravity | 0.918 | | color | Colorless to Almost colorless | | Water Solubility | Immiscible with water. | | BRN | 1888727 | | Cosmetics Ingredients Functions | FILM FORMING | | InChI | 1S/C16H38O5Si4/c1-15(2)16(17)18-13-12-14-25(19-22(3,4)5,20-23(6,7)8)21-24(9,10)11/h1,12-14H2,2-11H3 | | InChIKey | BESKSSIEODQWBP-UHFFFAOYSA-N | | SMILES | CC(=C)C(=O)OCCC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C | | LogP | 9 at 20℃ | | CAS DataBase Reference | 17096-07-0(CAS DataBase Reference) | | NIST Chemistry Reference | Tris(trimethylsiloxy)-3-methacryloxypropylsilane(17096-07-0) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 10 | | TSCA | No | | HS Code | 29319090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-(METHACRYLOYLOXY)PROPYLTRIS(TRIMETHYLSILOXY)SILANE Usage And Synthesis |
| Advantages |
3-(Methacryloyloxy)propyltris(trimethylsiloxy)silane is a silane-modified methacrylate characterized by its unique siloxy functional groups, which impart hydrophobicity and thermal stability.
| | Chemical Properties | Colorless transparent liquid | | Uses |
3-(Methacryloyloxy)propyltris(trimethylsiloxy)silane acts as a tetramethylsilane-protected silicate compound utilized for proteomics research. It is also used as a silane coupling agent, silane adhesion promoter, silane hydrophobing agent, silane dispersing agent and silane crosslinking agent. It is also employed as a silane moisture scavenger, polypropylene catalyst, silicate stabilizer, polyurethane endcapper silane, silane drying agent, silane curing agent and silane reinforcer. Further, it serves as a silylating agent, silane reducing agent, silyl building block and synthons in synthetic chemistry.
| | Reactions |
3-(Methacryloyloxy)propyltris(trimethylsiloxy)silane forms explosive mixtures with air on intense heating.
| | Flammability and Explosibility | Not classified | | Synthesis | To a 500 mL three-necked flask equipped with a constant pressure dropping funnel, magnetic stirrer, Dean-Stark splitter and condenser tube, 124.18 g (0.5 mol) of 3-(methacryloyloxy)propyltrimethoxysilane was added under nitrogen protection, followed by 0.15 g of trifluoromethanesulfonic acid and 0.15 g of BHT.A 198.35 g (1.5 mol) of trimethylsilyl acetate was added to the reaction flask by slow dropwise addition through the constant pressure dropping funnel at 80 °C. 198.35 g (1.5 mol) trimethylsilyl acetate to the reaction flask. During the dropwise addition, most of the low-boiling by-products were continuously distilled and collected through a Dean-Stark splitter side tube. After the dropwise addition was completed, stirring of the reaction mixture was continued for 1 hour. The reaction mixture was transferred to a dispensing funnel and washed six times with 100 mL of water until a neutral colorless clear liquid was obtained. A small amount of low-boiling impurities was removed by rotary evaporation under reduced pressure to yield 198.08 g of 3-(1,1,1,5,5,5-hexamethyl-3-((trimethylsilyl)oxy)trisiloxan-3-yl)propyl methacrylate in 93.7% yield. | | References | [1] Patent: CN103554169, 2016, B. Location in patent: Paragraph 0040-0042 |
| | 3-(METHACRYLOYLOXY)PROPYLTRIS(TRIMETHYLSILOXY)SILANE Preparation Products And Raw materials |
|