Propargyl p-toluenesulfonate manufacturers
|
| | Propargyl p-toluenesulfonate Basic information |
| | Propargyl p-toluenesulfonate Chemical Properties |
| Boiling point | 117-121°C 0,3mm | | density | 1.215 g/mL at 20 °C (lit.) | | refractive index | n20/D 1.530 | | Fp | 117-121°C/0.3mm | | storage temp. | 2-8°C | | solubility | soluble in Chloroform, Dichloromethane, DMSO, Ethyl Acetate | | form | Liquid | | color | Clear colorless to brown | | Water Solubility | Soluble in Chloroform, Dichloromethane, DMSO, Ethyl Acetate. Not miscible in water. | | BRN | 1212957 | | InChI | InChI=1S/C10H10O3S/c1-3-8-13-14(11,12)10-6-4-9(2)5-7-10/h1,4-7H,8H2,2H3 | | InChIKey | LMBVCSFXFFROTA-UHFFFAOYSA-N | | SMILES | C(OS(C1=CC=C(C)C=C1)(=O)=O)C#C |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | RTECS | XT7300000 | | F | 4.10-10-21 | | HS Code | 29041000 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Propargyl p-toluenesulfonate Usage And Synthesis |
| Chemical Properties | Clear colorless to brown liquid | | Uses | Protected Propargyl. A possible genotoxic compound that can affect the bacterial and mammalian cell systems. | | Uses | Propargyl p-toluenesulfonate is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff. | | Uses | Propargyl p-toluenesulfonate can be used as an initiator in the synthesis of linear and cyclic poly(2-isopropyl-2-oxazoline)s by cationic ring-opening polymerization of 2-isopropyl-2-oxazoline.
It can also be used as a reagent to synthesize:
- 2-hydroxy-4-pentynoic acid by an alkylation reaction with diethyl 2-acetamidomalonate followed by subsequent hydrolysis, decarboxylation, diazotization, and hydroxylation reactions.
- Furan derivatives by Pd-catalyzed reaction with acylchromates.
|
| | Propargyl p-toluenesulfonate Preparation Products And Raw materials |
|