- Ganoderic Acid H
-
- $0.00 / 5mg
-
2023-02-24
- CAS:98665-19-1
- Min. Order: 5mg
- Purity: ≥95%(HPLC)
- Supply Ability: 10 g
|
| | GANODERIC ACID H Basic information |
| Product Name: | GANODERIC ACID H | | Synonyms: | 12β-Acetoxy-3β-hydroxy-7,11,15,23-tetraoxo-5α-lanosta-8-ene-26-oic acid;12β-Acetyloxy-3β-hydroxy-7,11,15,23-tetraoxo-5α-lanost-8-en-26-oic acid;12.beta.-Acetyloxy-3.beta.-hydroxy-7,11,15,23-tetraoxolanost-8-en-26-oic acid;Aids070762;Aids-070762;GANODERIC ACID H;(3beta,12beta)-12-(acetyloxy)-3-hydroxy-7,11,15,23-tetraoxo- lanost-8-en-26-oic acid;GANODERIC ACID H USP/EP/BP | | CAS: | 98665-19-1 | | MF: | C32H44O9 | | MW: | 572.69 | | EINECS: | | | Product Categories: | Miscellaneous Natural Products | | Mol File: | 98665-19-1.mol |  |
| | GANODERIC ACID H Chemical Properties |
| Melting point | 155~156℃ | | Boiling point | 710.0±60.0 °C(Predicted) | | density | 1.25±0.1 g/cm3 (20 ºC 760 Torr) | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 4.77±0.23(Predicted) | | form | Powder | | color | Off-white to light yellow | | InChIKey | YCXUCEXEMJPDRZ-YIRLAGBYSA-N | | SMILES | [C@@H]1(O)[C@@]([C@]2([C@](C)(CC1)C1=C([C@]3([C@@]([C@H](OC(C)=O)C1=O)(C)[C@@H]([C@H](C)CC(=O)CC(C)C(O)=O)CC3=O)C)C(=O)C2)[H])(C)C |
| | GANODERIC ACID H Usage And Synthesis |
| Uses | Ganoderic Acid H, is a new lanostanoid triterpene extracted from the fruit bodies of Ganoderma Lucidum mushroom. these compounds are shown to possess many therapeutic properties. They can be used as anti-virus, anti-inflammation, anti-tumor, immunity-promoting, anti-diabetic, etc. | | Definition | ChEBI: Ganoderic acid H is a triterpenoid. |
| | GANODERIC ACID H Preparation Products And Raw materials |
|