2-PHENYLETHANETHIOAMIDE manufacturers
|
| | 2-PHENYLETHANETHIOAMIDE Basic information |
| Product Name: | 2-PHENYLETHANETHIOAMIDE | | Synonyms: | 2-PHENYLETHANETHIOAMIDE;OTAVA-BB BB7018890438;2-Phenylthioacetamide, 97%;Benzeneethanethioamide;NSC 235948;NSC 52357;Phenylacetothioamide;Acetamide, 2-phenylthio- | | CAS: | 645-54-5 | | MF: | C8H9NS | | MW: | 151.23 | | EINECS: | | | Product Categories: | | | Mol File: | 645-54-5.mol |  |
| | 2-PHENYLETHANETHIOAMIDE Chemical Properties |
| Melting point | 96-98°C | | Boiling point | 277.3±33.0℃ (760 Torr) | | density | 1.155±0.06 g/cm3 (20 ºC 760 Torr) | | Fp | 121.5±25.4℃ | | storage temp. | Storage temp. 2-8°C | | pka | 13.10±0.29(Predicted) | | form | powder to crystal | | color | White to Orange to Green | | Water Solubility | Slightly Soluble in water (1.8 g/L) (25°C). | | InChI | InChI=1S/C8H9NS/c9-8(10)6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,9,10) | | InChIKey | CJXBHFANXQMZBF-UHFFFAOYSA-N | | SMILES | C1(CC(N)=S)=CC=CC=C1 |
| HazardClass | IRRITANT | | HS Code | 2924190090 |
| | 2-PHENYLETHANETHIOAMIDE Usage And Synthesis |
| Uses | 2-Phenylthioacetamide find extensive use in organic synthesis. N-bromo and N-chloro succinimides are halogenating agents. Phthalimides are used in the synthesis of primary amines. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 58, p. 4742, 1993 DOI: 10.1021/jo00069a046
Synthesis, p. 887, 1979 DOI: 10.1055/s-1979-28861 |
| | 2-PHENYLETHANETHIOAMIDE Preparation Products And Raw materials |
|