| Company Name: |
BePharm Ltd |
| Tel: |
400-685-9117 |
| Email: |
market@bepharm.com |
|
| | Ethyl 4-dimethylaminobenzoylformate Basic information |
| Product Name: | Ethyl 4-dimethylaminobenzoylformate | | Synonyms: | ETHYL 4-(N,N-DIMETHYLAMINO)BENZOYLFORMATE;Ethyl 2-(4-(dimethylamino)phenyl)-2-oxoacetate;(4-Dimethylaminophenyl)oxoacetic acid ethyl ester;Benzeneacetic acid, 4-(dimethylamino)-α-oxo-, ethyl ester;Ethyl 4-dimethylaminobenzoylformate | | CAS: | 41116-24-9 | | MF: | C12H15NO3 | | MW: | 221.25 | | EINECS: | | | Product Categories: | | | Mol File: | 41116-24-9.mol |  |
| | Ethyl 4-dimethylaminobenzoylformate Chemical Properties |
| Melting point | 92-93°C | | Boiling point | 343.1±25.0 °C(Predicted) | | density | 1.131±0.06 g/cm3(Predicted) | | pka | -0.22±0.12(Predicted) | | form | solid | | InChI | 1S/C12H15NO3/c1-4-16-12(15)11(14)9-5-7-10(8-6-9)13(2)3/h5-8H,4H2,1-3H3 | | InChIKey | IEQWYUJSPBZCTP-UHFFFAOYSA-N | | SMILES | CCOC(=O)C(=O)c1ccc(cc1)N(C)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Ethyl 4-dimethylaminobenzoylformate Usage And Synthesis |
| | Ethyl 4-dimethylaminobenzoylformate Preparation Products And Raw materials |
|