|
|
| | (PHENYLSULFONYL)ACETONITRILE Basic information |
| | (PHENYLSULFONYL)ACETONITRILE Chemical Properties |
| Melting point | 112-114 °C(lit.) | | Boiling point | 398.5±34.0 °C(Predicted) | | density | 1.284±0.06 g/cm3 (20 ºC 760 Torr) | | refractive index | 1.5650 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | color | White to Almost white | | BRN | 640716 | | InChI | InChI=1S/C8H7NO2S/c9-6-7-12(10,11)8-4-2-1-3-5-8/h1-5H,7H2 | | InChIKey | ZFCFFNGBCVAUDE-UHFFFAOYSA-N | | SMILES | C(#N)CS(C1=CC=CC=C1)(=O)=O | | CAS DataBase Reference | 7605-28-9(CAS DataBase Reference) |
| Hazard Codes | T,Xi | | Risk Statements | 23/24/25-36/37/38 | | Safety Statements | 36/37/39-45-36-26 | | RIDADR | 3276 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 2930909899 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | (PHENYLSULFONYL)ACETONITRILE Usage And Synthesis |
| Chemical Properties | White to off-white-greyish crystalline powder | | Uses | (Phenylsulfonyl)acetonitrile was used in the synthesis of pyridines, chromenes and thiophene derivatives based on sulfones. | | Synthesis Reference(s) | Synthesis, p. 56, 1987 DOI: 10.1055/s-1987-27843 | | General Description | Condensation reaction of (phenylsulfonyl)acetonitrile with benzaldehyde in water in heterogeneous phase in the presence and absence of anionic and cationic surfactants has been studied. Dehydrative alkylation of alcohols with (phenylsulfonyl)acetonitrile under modified Mitsunobu conditions has been investigated. |
| | (PHENYLSULFONYL)ACETONITRILE Preparation Products And Raw materials |
|