|
|
| | 4-tert-Butyl N-[(tert-butoxy)carbonyl]-L-aspartate dicyclohexylamine salt Basic information |
| | 4-tert-Butyl N-[(tert-butoxy)carbonyl]-L-aspartate dicyclohexylamine salt Chemical Properties |
| Melting point | 145-147 °C | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Solid | | Major Application | peptide synthesis | | InChIKey | OMYRDWOMNDCKEJ-QRPNPIFTSA-N | | SMILES | [N+H2](C2CCCCC2)C1CCCCC1.N([C@@H](CC(=O)OC(C)(C)C)C(=O)[O-])C(=O)OC(C)(C)C | | CAS DataBase Reference | 1913-12-8(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 2924 19 00 | | Storage Class | 11 - Combustible Solids |
| | 4-tert-Butyl N-[(tert-butoxy)carbonyl]-L-aspartate dicyclohexylamine salt Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | 4-tert-Butyl N-[(tert-butoxy)carbonyl]-L-aspartate dicyclohexylamine salt Preparation Products And Raw materials |
|