| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
PF-06748962 manufacturers
- PF-06748962
-
- $2380.00
-
2026-05-11
- CAS:1952261-87-8
- Purity:
- Supply Ability: 10g
|
| | PF-06748962 Basic information |
| Product Name: | PF-06748962 | | Synonyms: | PF-06748962;2(1H)-Pyridinone, 3-[(3R)-3-methyl-2-oxo-3-piperidinyl]-6-(5-methyl-3-quinolinyl)-;PF-06748962 >=98% (HPLC) | | CAS: | 1952261-87-8 | | MF: | C21H21N3O2 | | MW: | 347.41 | | EINECS: | | | Product Categories: | | | Mol File: | 1952261-87-8.mol |  |
| | PF-06748962 Chemical Properties |
| storage temp. | room temp | | solubility | DMSO: 20mg/mL, clear | | form | powder | | color | white to beige | | Optical Rotation | [α]/D -880 to -920°, c = 0.5 in chloroform-d | | SMILES | CC1=CC=CC2=NC=C(C3=CC=C([C@]4(C)C(NCCC4)=O)C(N3)=O)C=C21 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | PF-06748962 Usage And Synthesis |
| Uses | EP3 antagonist 2 (Compound Exp 1) is a potent and selective EP3 receptor antagonist. EP3 antagonist 2 has a strong binding affinity for the human EP3 receptor (Ki: 3.3 nM) and significant antagonistic activity (IC50: 30.8 nM, determined by cellular cAMP levels)[1]. | | Biological Activity | PF-06748962 is a potent and selective lactam-based prostaglandin EP3 receptor antagonist. | | References | [1] Kevin Bahnck, et al. Antagonists of prostaglandin ep3 receptor. US20160176851A1. 2016-06-23. |
| | PF-06748962 Preparation Products And Raw materials |
|