|
|
| | 2-Methoxy-3-nitropyridine Basic information |
| | 2-Methoxy-3-nitropyridine Chemical Properties |
| Melting point | 53-55°C | | Boiling point | 247.9±20.0 °C(Predicted) | | density | 1.300±0.06 g/cm3(Predicted) | | Fp | >110℃ | | storage temp. | Inert atmosphere,Room Temperature | | form | powder to crystal | | pka | -0?+-.0.10(Predicted) | | color | White to Amber | | BRN | 138199 | | InChI | InChI=1S/C6H6N2O3/c1-11-6-5(8(9)10)3-2-4-7-6/h2-4H,1H3 | | InChIKey | WZNQCVOSOCGWJG-UHFFFAOYSA-N | | SMILES | C1(OC)=NC=CC=C1[N+]([O-])=O | | CAS DataBase Reference | 20265-35-4(CAS DataBase Reference) |
| | 2-Methoxy-3-nitropyridine Usage And Synthesis |
| Uses | 2-Methoxy-3-nitropyridine is a pyridine compound used as a reagent in chemical reactions or as an intermediate component in organic synthesis. It can be reduced to amines and then converted to N-substituted derivatives. | | Preparation | 2-Methoxy-3-nitropyridine can be prepared by methylation of 2-hydroxy-3-nitropyridine[1]. | | Synthesis | Example 12 Synthesis of 2-methoxy-3-nitropyridine STR27: 2-chloro-3-nitropyridine (25 g, 0.157 mol) was suspended in methanol (300 ml), followed by addition of sodium methanolate (17 g, 0.315 mol). The reaction mixture was heated to reflux for 2 hours. After completion of the reaction, some of the solvent was removed by distillation under reduced pressure. The remaining reaction mixture was diluted with water (1 liter) and filtered to collect the precipitate precipitated. The resulting white solid was washed with copious amounts of water and subsequently dried under vacuum to afford the target product 2-methoxy-3-nitropyridine (18.2 g, 75% yield). The structure of the product was confirmed by 1H NMR (CDCl3): δ 8.42 (dd, J = 5,2 Hz, 1H); 8.28 (dd, J = 8,2 Hz, 1H); 7.06 (dd, J = 8,5 Hz, 1H); 4.13 (s, 3H). | | References | [1] GRUBER W. PYRIDINE DERIVATIVES: PART VI MALONATIONS OF SUBSTITUTED NITROPYRIDINES[J]. Canadian Journal of Chemistry, 1953. DOI:10.1139/V53-152. |
| | 2-Methoxy-3-nitropyridine Preparation Products And Raw materials |
|