Methanone, cyclopentyl-2-thienyl- manufacturers
|
| | Methanone, cyclopentyl-2-thienyl- Basic information |
| Product Name: | Methanone, cyclopentyl-2-thienyl- | | Synonyms: | Methanone, cyclopentyl-2-thienyl-;cyclopentyl-2-thienyl-;cyclopentyl(thiophen-2-yl)methanone;cyclopentyl thien-2-yl ketone;Cyclopentyl-2-thienylmethanone;6-Cyclopentylthiophene-2-yl ketone | | CAS: | 99186-05-7 | | MF: | C10H12OS | | MW: | 180.26668 | | EINECS: | 619-401-2 | | Product Categories: | | | Mol File: | 99186-05-7.mol |  |
| | Methanone, cyclopentyl-2-thienyl- Chemical Properties |
| InChI | InChI=1S/C10H12OS/c11-10(8-4-1-2-5-8)9-6-3-7-12-9/h3,6-8H,1-2,4-5H2 | | InChIKey | ZLEDQHMUUGXXTD-UHFFFAOYSA-N | | SMILES | C(C1CCCC1)(C1SC=CC=1)=O |
| | Methanone, cyclopentyl-2-thienyl- Usage And Synthesis |
| | Methanone, cyclopentyl-2-thienyl- Preparation Products And Raw materials |
|