|
|
| | 2-METHYLBENZOYL CYANIDE Basic information |
| Product Name: | 2-METHYLBENZOYL CYANIDE | | Synonyms: | 2-(2-methylphenyl)-2-oxoacetonitrile;2-METHYLBENZOYL CYANIDE;2-methyl phenyl glyoxylonitrile;Benzeneacetonitrile, 2-Methyl-a-oxo-;OXO-O-TOLYL-ACETONITRILE;(2-methylphenyl)(oxo)acetonitrile;Benzeneacetonitrile, 2-methyl-α-oxo-;2-METHYLBENZOYL | | CAS: | 5955-73-7 | | MF: | C9H7NO | | MW: | 145.16 | | EINECS: | 200-258-5 | | Product Categories: | | | Mol File: | 5955-73-7.mol |  |
| | 2-METHYLBENZOYL CYANIDE Chemical Properties |
| Boiling point | 127 °C(Press: 29 Torr) | | density | 1.111±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C9H7NO/c1-7-4-2-3-5-8(7)9(11)6-10/h2-5H,1H3 | | InChIKey | WYXWANVHOUGOBI-UHFFFAOYSA-N | | SMILES | N#CC(=O)C1=CC=CC=C1C |
| | 2-METHYLBENZOYL CYANIDE Usage And Synthesis |
| Chemical Properties | Colorless liquid | | Uses | 2-Methylbenzoyl Cyanide-d7 is an intermediate used in the synthesis of Trifloxystrobin-d6 (T778902), which is the labelled analogue of Trifloxystrobin, a broad-spectrum foliar fungicide used in plant pritection. Trifloxystrobin functions by inhibiting fungal spore germination. Cannabis testing. |
| | 2-METHYLBENZOYL CYANIDE Preparation Products And Raw materials |
|